Home
Class 10
CHEMISTRY
A+BrarrEthyl ethanoate + water a) Ide...

`A+BrarrEthyl ethanoate + water`
a) Identify A and B
b) Write the molecular formula of ethyl ethanoate

Text Solution

Verified by Experts

a) A-Ethyl alcohol B-Ethanoic acid
b) `CH_(3)CH_(3)COOCH_(3)`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Try to write down their molecular formula.

Identify 'A' and 'B' in the following.

a) Identify the picture. b) Write the peculiarity of the picture.

. Identify the products B and C and write their formulae.

Identify A, B, in the following :

Observe the diagram and identify A & B.

Write the metamers corresponding to the molecular formula C_4H_10O

Hydrogen peroxide is an important chemical used in pollution control treatment of domestic and in dustrial effluents.Write the molecular formula of hydrogen peroxide.

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Analyse the given reaction and answer the following questions. a) I...

    Text Solution

    |

  2. The equation of a chemical reaction is given below. a. To which typ...

    Text Solution

    |

  3. A+BrarrEthyl ethanoate + water a) Identify A and B b) Write the...

    Text Solution

    |

  4. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  5. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  6. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  7. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  8. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  9. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  10. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  11. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  12. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  13. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  14. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  15. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  16. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  17. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  18. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  19. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  20. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |