Home
Class 10
CHEMISTRY
Write down the products of the combustio...

Write down the products of the combustion of the following hydrocarbons.
a. 2-butene
b. 1-pentene

Text Solution

Verified by Experts

a) `CH_(3)CH=CHCH_(3)+6O_(2)rarr4CO_(2)+4H_(2)O`
b)`CH_(3)CH_(2)CH_(2)CH=CH_(2)+7/2O_(2)rarr5CO_(2)+5H_(2)O`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Write chemical equations of combustion reaction of the following hydrocarbons. i. Butane

Write the structures of the products of the following reactions

Write the structures of the products of the following reactions

Write the structures of the products of the following reactions

Write chemical equation for combustion reaction of the following hydrocarbons Butane

Write chemical equation for combustion reaction of the following hydrocarbons Toluene

Write down the structural formulae of the following compounds: Cyclobutene

Write down the structural formula of the following componds. a) Cyclopentane b) Cyclobutene

Write down the structural formulae of the following compounds: Cyclopentane

Write down the number of significant figures in the following: 421

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. The equation of a chemical reaction is given below. a. To which typ...

    Text Solution

    |

  2. A+BrarrEthyl ethanoate + water a) Identify A and B b) Write the...

    Text Solution

    |

  3. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  4. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  5. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  6. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  7. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  8. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  9. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  10. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  11. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  12. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  13. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  14. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  15. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  16. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  17. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  18. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  19. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  20. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |