Home
Class 10
CHEMISTRY
Some organic compounds are given below. ...

Some organic compounds are given below.
(`CH_(3)OH`, `CH_(3)COOH`, `CH_(3)CH_(3)`, `CH_(3)OCH_(3)`
a) Pickout compounds which can be used to make an ester?
b) Write down the chemical reaction of it.

Text Solution

Verified by Experts

a) `CH_(3)OH` `CH_(3)COOH`
b)`CH_(3)COOH+OHCH_(3)rarrCH_(3)COOH+H_(2)O`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Some organic compounds are given below: [CH_3-OH, CH_3-COOH, CH_3-CH_3, CH_3-O-CH_3] : write their IUPAC names.

Some organic compounds are given below: [CH_3-OH, CH_3-COOH, CH_3-CH_3, CH_3-O-CH_3] : Which of the above compounds are used to produce Esther?

The Structural formula of two organic compounds are given below i) CH_(3)CH_(2)CH_(2)OH ii) CH_(3)OCH_(2)CH_(3) a) What are the IUPAC names of these comounds? What is the this phenomenon known as? b) Write the functional group of these two compounds?

Examine the compound given below and write answer to the questions. CH_(3)CHO . CH_(3)OH , CH_(3)OH , CH_(3)COOH , CH_(3)COOCH_(3) a) What are the chemical substance needed for the manufacture of an ester? b) Write the chemical equation denoting this reaction. c) Write any two uses of ester.

Esters are organic compounds having the characteristic smell of flowers and fruits. The formation of an ester is given below. CH_(3)CH_(2)COOH+HOCH_(2)CH_(3)rarrCH_(3)CH_(2)COOCH_(2)CH_(3)+H_(2)O a) identify the acid and alcohol in the reaction. b) Write the chemical equation of the reaction taking place when CH_(3)CH_(2)COOH is replaced by ethanoic acid( CH_(3)COOH )

IUPAC nomenclature of the given organic compound will be (CH_(3))_(2)C(CH_(2)CH_(3))CH_(2)CH(Cl)CH_(3)

The Structural formula of two organic compounds are given i) CH_(3)OCH_(2)CH_(3) ii) CH_(3)CH_(2)CH_(2)OH a) What are the IUPAC names of these comounds? b) Write one similarity and one difference between these two compounds c) what is this phenomenon knowns as?

Some compounds are given below a) CH_(2)=CHCH_(2)CH_(3) b) CH_(3)CH_(2)CH_(3) c) CH_(3)CH=CH_(2) d) CH_(4) e) CH_(3)CH_(2)CH_(2)CH_(3) a) Which of these compounds can form polymer ? b) what are the products obtained by the thermal cracking of 'B' ?

The structure of two organic compounds are given below: i) CH_3-CH_2-CH_2-CH_2-OH ii) CH_3-CH_2-O-CH_2-CH_3 Explain this isomerism.

Write the IUPAC names of the compounds given below: CH_3-CH_2-CO-CH_3

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. A+BrarrEthyl ethanoate + water a) Identify A and B b) Write the...

    Text Solution

    |

  2. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  3. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  4. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  5. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  6. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  7. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  8. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  9. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  10. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  11. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  12. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  13. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  14. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  15. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  16. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  17. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  18. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  19. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |

  20. a) What is the polymerisation? b) Write the monomer of the followi...

    Text Solution

    |