Home
Class 10
CHEMISTRY
CH(4)+Cl(2)rarr(sunlight)A+HCl a) Ide...

`CH_(4)+Cl_(2)rarr(sunlight)A+HCl`
a) Identify the compound 'A'
b) To which type does this reaction belong? (Addition Reaction, Substitution Reaction, Combustion, Polymerisation)

Text Solution

Verified by Experts

a) `CH_(3)Cl`
b) Substitution reaction
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Examine the reactions given below: i) CH_(4)+Cl_(2)rarrCH_(3)+HCl ii) nCH_(2)=CH_(2)rarr(CH_(2)-CH_(2))_(n) iii) C_(6)H_(14)rarrC_(2)H_(6)+C_(4)H_(6) iv) CH_(3)OH+CH_(3)COOHrarrCH_(3)COOCH_(3)+H_(2)O Identify the following types of reactions from the above equations. a) Esterification reaction b) Thermal cracking c) Polymerisation d) Substitution reaction

Which of the following compounds undergo nuclephilic substitution reactions?

Which of the following compounds undergoes nucleophilic substitution reaction with aqueous NaOH?

Note the chemical reactions given below. i) nCH_(2)=CH-Clrarr[-CH_(2)CH-Cl]_(n) ii) CH_(2)=CH_(2)+Cl_(2)rarrCH_(2)Cl-CH_(2)Cl iii) CH_(3)COOH+OH-CH_(2)CH_(3)rarrCH_(3)COOCH_(2)CH_(3)+H_(2)O a) Identify the polymerisation reaction. b) From the products of three reactions given, find out ethyl ethanoate. c) Give the products of reaction if HCl is used instead of Cl_(2) in reaction(ii)

Analyse the equations and answer the equation below. 1. CH_(4)+Cl_(2)rarrA+HCl 2. CH_(4)+2O_(2)rarrB+C+Heat 3. nCH_(2)=CH_(2)rarrD a) What are A, B, C and D b) Name the product 'D' formed during the third reaction? c) To which type of reaction does first equation belong?

Examine the structural formula of the following compounds. C_(2)H_(4) , CH_(3)Cl , C_(2)H_(2)Cl_(2) , C_(2)H_(2) , C_(3)H_(8) , C_(3)H_(6) , C_(3)H_(4) , C_(3)H_(3)Cl classify them as in the following manner. a) Molecules which undergo substitution reaction b) Molecules which undergo addition reaction. c) Molecules which can ploymerise.

Consider the equation H_2 + Cl_2 rarr 2HCl Which atom was reduced during this reaction ?

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Write down the products of the combustion of the following hydrocarbon...

    Text Solution

    |

  2. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  3. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  4. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  5. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  6. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  7. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  8. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  9. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  10. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  11. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  12. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  13. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  14. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  15. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  16. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  17. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  18. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |

  19. a) What is the polymerisation? b) Write the monomer of the followi...

    Text Solution

    |

  20. Uses of some organic compounds are given below. Choose the appropriate...

    Text Solution

    |