Home
Class 10
CHEMISTRY
Write the products formed in the followi...

Write the products formed in the following addition reactions.
a) `CH_(2)=CH_(2)+HClrarr......`
b)`CH-=CH+2H_(2)rarr......`

Text Solution

Verified by Experts

a) `CH_(3)CH_(2)Cl`
b)`CH_(3)CH_(3)`
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

CH-=CH+O_(2)rarr.....+......

Complete the following reactions: CH_3-CH = CH_2 + HCl rarr

Predict the product in the following reactions and identify the rules: CH_3CH=CH_2+HBr to B

Predict the products of the following reactions CH_3-CH_2-CH_2-O-CH_3+HBr rarr

What is the major product of the following reaction? CH_3 C equiv C-CH_2 CH_3 + 1moleof Cl_2 rarr

Complete the equation fot the following chemical reaction. Name this reaction. CH_(3)CH_(2)CH_(2)CH_(3)+O_(2)rarr........+....

Write the structues of te product of the following reactons. (iii) CH_3-C-=CH overset(Hg^(2+)H_2SO_4)rarr

Write the main product in the following reactions (a) ( CH_3)_2 CH- Cl overset((N_ a)/ (dry ether )) (b) C H_3 B r+A g F rarr oversetDelta ,

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Some organic compounds are given below. (CH(3)OH, CH(3)COOH, CH(3)C...

    Text Solution

    |

  2. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  3. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  4. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  5. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  6. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  7. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  8. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  9. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  10. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  11. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  12. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  13. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  14. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  15. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  16. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  17. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |

  18. a) What is the polymerisation? b) Write the monomer of the followi...

    Text Solution

    |

  19. Uses of some organic compounds are given below. Choose the appropriate...

    Text Solution

    |

  20. Fill up the missing part of the followig diagram suitably.

    Text Solution

    |