Home
Class 10
CHEMISTRY
CH(3)COOH+CH(3)OHrarrA+H(2)O a) Writ...

`CH_(3)COOH+CH_(3)OHrarrA+H_(2)O`
a) Write the molecular formula of 'A' and complete the equation.
b) To which category of compounds does'A' belong?

Text Solution

Verified by Experts

a) `CH_(3)COOCH_(3)`
b) Esters
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

CH_3-underset(CH_3)underset(|)(CH)-CH_3 Write the molecular formula.

CH_(3)CH(Cl)CH_(3) a) Write the molecular formula of the compound b) What is the functional group in it? c) Write the IUPAC name of the compound. d) Give the condensed formula of the isomer of this compound.

Write the molecular formula with the IUPAC name of the following compound. H-COOH

Write the molecular formula with the IUPAC names of the following compounds. CH_3-CH_2-CH_2-CH_2-CHO

i) CH_(3)OCH_(3) ii) CH_(3)CH_(2)OH a) Write the IUPAC names of the given compounds given above. b) Which type of isomers are these compounds?

Chemical equations of some reactions are given below. i) CH_(2)=CH_(2)+HClrarrCH_(3)CH_(2)Cl ii) nCH_(2)=CH_(2)rarr(CH_(2)-CH_(2))_(n) iii) CH_(3)COOH+CH_(3)CH_(2)OHrarrCH_(3)COOCH_(2)CH_(3)+H_(2)O a) Write the names of any two reactions. b) Write the IUPAC name of the product formed in the third reacrion. c) Write the chemical equation for the preparation of propyl ethanoate.

write the molecular formula with the IUPAC names of the following compound. CH_3-CH_2-CH=CH-CH_2-CH_3

Esters are organic compounds having the characteristic smell of flowers and fruits. The formation of an ester is given below. CH_(3)CH_(2)COOH+HOCH_(2)CH_(3)rarrCH_(3)CH_(2)COOCH_(2)CH_(3)+H_(2)O a) identify the acid and alcohol in the reaction. b) Write the chemical equation of the reaction taking place when CH_(3)CH_(2)COOH is replaced by ethanoic acid( CH_(3)COOH )

Match the molecular formula with the IUPAC names of the following compounds. CH_3-CH_2-CH_2-CH_2-O-CH_3

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. CH(4)+Cl(2)rarr(sunlight)A+HCl a) Identify the compound 'A' b)...

    Text Solution

    |

  2. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  3. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  4. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  5. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  6. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  7. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  8. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  9. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  10. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  11. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  12. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  13. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  14. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  15. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  16. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |

  17. a) What is the polymerisation? b) Write the monomer of the followi...

    Text Solution

    |

  18. Uses of some organic compounds are given below. Choose the appropriate...

    Text Solution

    |

  19. Fill up the missing part of the followig diagram suitably.

    Text Solution

    |

  20. Analyse the equations and answer the equation below. 1. CH(4)+Cl(2...

    Text Solution

    |