Home
Class 10
CHEMISTRY
nCH(2)=CHClrarr.... a) Name the produ...

`nCH_(2)=CHClrarr....`
a) Name the product and what type of reaction is this?
b) Write the name of monomer in it.
c) Give examples for two natural polymer

Text Solution

Verified by Experts

a) `nCH_(2)=CHClrarr[-CH(Cl)CH-]`
b) Vinyl chloride
c) Polyisoproprene protein
Promotional Banner

Topper's Solved these Questions

  • COMPOUNDS OF NON -METALS

    V PUBLICATION|Exercise QUESTION BANK|62 Videos

Similar Questions

Explore conceptually related problems

Name the product and what type of reaction is this? nCH_2=CHCIrarr ………….

n C H 2 = C H C l → ... . Write down the names of monomer in it.

Write the names of the monomers of the following polymers

. Product (B) and name of the reaction in the formation of (B) are:

nCH_(2)=CHClrarr......... a) Give Structure of the product formed. b) Write the common name of the product c) Name of the monomer of this reaction.

Write the names and structures of monomers present in the following polymers. Teflon

CH_(3)CH=CH_(2)+Cl_(2)rarrA a) Which is the reactant hydrocarbon ? b) Write the name of product 'A'? c) Write the name of the reaction?

a) What is the polymerisation? b) Write the monomer of the following ploymers. i) PVC ii ) Polyethene iii) Natural rubber

nCH_(2)=CH_(2)rarr[-CH_(2)-CH_(2)-]_(n) a) Which is the monomer of this reaction? b) Write the name of polymer. c) Which type of chemical reaction is this?

V PUBLICATION-CHEMICAL NAME OF ORGANIC COMPOUNDS-QUESTION BANK
  1. Write the products formed in the following addition reactions. a) ...

    Text Solution

    |

  2. CH(3)COOH+CH(3)OHrarrA+H(2)O a) Write the molecular formula of 'A'...

    Text Solution

    |

  3. nCH(2)=CHClrarr.... a) Name the product and what type of reaction i...

    Text Solution

    |

  4. Some reactions regarding the production of an alcohol are given below....

    Text Solution

    |

  5. Ethanol is an industrially important compound. a) What is the name...

    Text Solution

    |

  6. Note the chemical reactions given below. i) nCH(2)=CH-Clrarr[-CH(2...

    Text Solution

    |

  7. Chemical equations of some reactions are given below. i) CH(2)=CH(2...

    Text Solution

    |

  8. Examine the structural formula of the following compounds. C(2)H(4), C...

    Text Solution

    |

  9. Examine the compound given below and write answer to the questions. CH...

    Text Solution

    |

  10. a) How is ethanoic acid prepared industrially? b) Write any two ue...

    Text Solution

    |

  11. Explain the following… a) Wash b) Rectified alcohol c) Absolute...

    Text Solution

    |

  12. CH(3)CH=CH(2)+Cl(2)rarrA a) Which is the reactant hydrocarbon ? ...

    Text Solution

    |

  13. Find out to which type of chemical reaction do the following changes b...

    Text Solution

    |

  14. I am a compound used in pickles as preservative. My molecular formula ...

    Text Solution

    |

  15. Three chemical reactions are given below. i) CH(3)CH(2)CH(2)CH(3)ra...

    Text Solution

    |

  16. a) What is the polymerisation? b) Write the monomer of the followi...

    Text Solution

    |

  17. Uses of some organic compounds are given below. Choose the appropriate...

    Text Solution

    |

  18. Fill up the missing part of the followig diagram suitably.

    Text Solution

    |

  19. Analyse the equations and answer the equation below. 1. CH(4)+Cl(2...

    Text Solution

    |

  20. Some compounds are given below a) CH(2)=CHCH(2)CH(3) b) CH(3)C...

    Text Solution

    |