Column I may match with more than one conditions of column II.
`{:("Column-I","Column-II"),((A)Ph-CH=CH-Ph,(p)"Ozonolysis followed by reaction with" `NH_2OH` "leads to more than one oxime prouduct"),((B)(CH_3)_2C=CH-undersetunderset(CH_3)(|)CH-Cl,(q)"Can exhibit geometrical isomers"),(( C)CH_2=CH-CH=CH_2,(r)"Compounds with this structure formula can be separated into different fractions upon fractional distillation"),((D)OHC-undersetunderset(OH)(|)(CH)CH-undersetunderset(OH)(|)(CH)-CHO,(s)"is capable of showing steroisomerism"),(,(t)"On hydrogenation it gives more than one product"):}`

Explanation

To solve the problem, we need to match the compounds in Column I with the corresponding statements in Column II based on their chemical properties and reactions. Let's analyze each compound in Column I step by step.

### Step 1: Analyze Compound A - Ph-CH=CH-Ph
- **Ozonolysis followed by reaction with NH2OH leads to more than one oxime product.**
- **Explanation:** The ozonolysis of this compound will cleave the double bond and produce two aldehyde or ketone products, which can then react with hydroxylamine (NH2OH) to form oximes. Therefore, this statement is true.

### Step 2: Analyze Compound B - (CH3)2C=CH-CH(CH3)Cl
- **Can exhibit geometrical isomers.**
- **Explanation:** This compound has a double bond and different substituents on either side of the double bond, allowing for cis-trans (geometric) isomerism. Thus, this statement is true.

### Step 3: Analyze Compound C - CH2=CH-CH=CH2
- **Compounds with this structure formula can be separated into different fractions upon fractional distillation.**
- **Explanation:** This compound is a diene and can be separated based on boiling points during fractional distillation. Therefore, this statement is true.

### Step 4: Analyze Compound D - OHC(OH)(CH)CH(OH)(CH)-CHO
- **Is capable of showing stereoisomerism.**
- **Explanation:** This compound has multiple chiral centers, which allows it to exhibit stereoisomerism. Thus, this statement is true.
- **On hydrogenation it gives more than one product.**
- **Explanation:** Hydrogenation can lead to different products depending on the conditions, such as the presence of stereochemistry. Therefore, this statement is also true.

### Summary of Matches:
- A matches with (p)
- B matches with (q)
- C matches with (r)
- D matches with (s) and (t)

### Final Matches:
- (A) → (p)
- (B) → (q)
- (C) → (r)
- (D) → (s), (t)