An alcoholic solution of dimethylglyoxime is added to an aqueous solution of nickel(II) chloride.Slow addition of ammonium hydroxide led to the precipitation of a bright-red coloured metal complex.
Find out the number of hydrogen bonds present in the structure of the complex.

Explanation

To solve the question regarding the number of hydrogen bonds in the complex formed by dimethylglyoxime and nickel(II) chloride, we can follow these steps:

### Step-by-Step Solution:

1. **Identify the Reactants**:
- We start with an alcoholic solution of dimethylglyoxime (C4H8N2O2) and an aqueous solution of nickel(II) chloride (NiCl2).

2. **Understand the Reaction**:
- When dimethylglyoxime is added to nickel(II) chloride, a coordination complex is formed. The reaction involves the formation of a bright-red colored complex due to the coordination of dimethylglyoxime with nickel ions.

3. **Write the Reaction Equation**:
- The reaction can be represented as:
\[ \text{NiCl}_2 + \text{dimethylglyoxime} \rightarrow \text{[Ni(dimethylglyoxime)]}^{2+} + 2\text{Cl}^- \]

4. **Draw the Structure of the Complex**:
- The structure of the nickel-dimethylglyoxime complex can be represented as:
```
CH3C(=O)C(=O)N(CH3)NiN(CH3)C(=O)C(=O)CH3
```
- In this structure, dimethylglyoxime acts as a bidentate ligand, coordinating through its two nitrogen atoms.

5. **Identify Hydrogen Bonding Sites**:
- In the structure of the complex, look for potential hydrogen bond donors and acceptors. The oxygen atoms in the dimethylglyoxime can act as hydrogen bond acceptors, while the hydrogen atoms attached to these oxygen atoms can act as hydrogen bond donors.

6. **Count the Hydrogen Bonds**:
- Each oxygen atom in the dimethylglyoxime can form a hydrogen bond with a hydrogen atom. In the structure, there are two oxygen atoms that can participate in hydrogen bonding, leading to a total of **2 hydrogen bonds**.

7. **Conclusion**:
- Therefore, the number of hydrogen bonds present in the structure of the complex is **2**.