Home
Class 12
CHEMISTRY
Total number of structural isomers possi...

Total number of structural isomers possible from molecular formula `C_(8)H_(18)` that contain `7` carbons in the parent chain are:

A

3

B

4

C

5

D

6

Text Solution

AI Generated Solution

The correct Answer is:
To determine the total number of structural isomers possible from the molecular formula \( C_8H_{18} \) that contain 7 carbons in the parent chain, we can follow these steps: ### Step 1: Understand the Molecular Formula The molecular formula \( C_8H_{18} \) indicates that we are dealing with an alkane, which follows the general formula \( C_nH_{2n+2} \). For \( n = 8 \), the formula is satisfied, confirming that we have a saturated hydrocarbon. **Hint:** Remember that alkanes are saturated hydrocarbons with single bonds only. ### Step 2: Draw the Parent Chain We need to establish a parent chain with 7 carbon atoms. This will be our main chain, and we will denote it as follows: ``` C1 - C2 - C3 - C4 - C5 - C6 - C7 ``` **Hint:** Visualize the carbon chain as a straight line of carbon atoms. ### Step 3: Identify the Remaining Carbon Since we have 8 carbons in total and 7 are in the parent chain, we have 1 carbon atom left to place as a substituent. **Hint:** Count the total number of carbons to ensure you are using all available carbons. ### Step 4: Determine Possible Substituent Positions Now, we can place the remaining carbon atom (as a methyl group, \( -CH_3 \)) at different positions along the parent chain. The possible positions for the substituent are: - Position 2 - Position 3 - Position 4 **Hint:** The substituent can be placed on any carbon in the chain except the terminal ones if you want to avoid redundancy. ### Step 5: Analyze the Substituent Positions 1. **Substituent at Position 2**: - Structure: ``` CH3 - C - C - C - C - C - C - CH3 | CH3 ``` 2. **Substituent at Position 3**: - Structure: ``` CH3 - C - C - C - C - C - C - CH3 | CH3 ``` 3. **Substituent at Position 4**: - Structure: ``` CH3 - C - C - C - C - C - C - CH3 | CH3 ``` ### Step 6: Count Unique Isomers - The substituent at position 2 is unique. - The substituent at position 3 is unique. - The substituent at position 4 is equivalent to position 2 due to symmetry (the chain can be flipped). Thus, the unique structural isomers are: 1. Substituent at position 2 2. Substituent at position 3 3. Substituent at position 4 (equivalent to position 2) **Hint:** Remember to check for symmetry and equivalent positions to avoid counting duplicates. ### Conclusion The total number of structural isomers possible from the molecular formula \( C_8H_{18} \) that contain 7 carbons in the parent chain is **3**. **Final Answer:** **3** (Option A)

To determine the total number of structural isomers possible from the molecular formula \( C_8H_{18} \) that contain 7 carbons in the parent chain, we can follow these steps: ### Step 1: Understand the Molecular Formula The molecular formula \( C_8H_{18} \) indicates that we are dealing with an alkane, which follows the general formula \( C_nH_{2n+2} \). For \( n = 8 \), the formula is satisfied, confirming that we have a saturated hydrocarbon. **Hint:** Remember that alkanes are saturated hydrocarbons with single bonds only. ### Step 2: Draw the Parent Chain ...
Promotional Banner

Topper's Solved these Questions

  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Advanced Level Problems Part-2 : Practice test-2|21 Videos
  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Advanced Level Problems Part-3|18 Videos
  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Exercise-3 Part-2|8 Videos
  • IONIC EQUILIBRIUM

    RESONANCE ENGLISH|Exercise partIII one or more than one options correct type|10 Videos
  • METALLURGY

    RESONANCE ENGLISH|Exercise ORGANIC CHEMISTRY(Alkyl Halide, Alcohol,Phenol,Ether)|17 Videos

Similar Questions

Explore conceptually related problems

The number of structure isomers possible from the molecular formula C_(3)H_(9)N is:

The number of structure isomers possible from the molecular formula C_(3)H_(9)N is:

How many structural isomers are possible from molecular formula C_(3)H_(9)N

Number of structural isomers represented by molecular formula C_4H_(10)O is

Then number of structurally isomeric compound(s) possible with molecular formula C_(8)H_(18) containing 5 carbons in main chain having methyl group(s) as side chain are

The total number of structural ethers possible with the molecular formula C_5H_(12)O ?

How many chain isomers are possible for molecular formula C_(6)H_(14) ?

The number of isomers possible for the molecular formula C_(2) FCIBrl is

The number of aromatic structures possible for the molecular formula C_7H_8O is

The number of isomers possible with molecular formula C_(2)H_(4)Cl_(2) is :

RESONANCE ENGLISH-IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM -Advanced Level Problems Part-1 : Practice test-1
  1. The IUPAC name of compound CH(3)-C(CH(3))(2)-CH(2)-CH=CH(2) is

    Text Solution

    |

  2. What is the structure of 4-Methylhex-5-en-3-ol.

    Text Solution

    |

  3. A compound having straight chain of five carbon atoms has one ketone g...

    Text Solution

    |

  4. What is the IUPAC name of

    Text Solution

    |

  5. What is the IUPAC name of compound is:

    Text Solution

    |

  6. The IUPAC name of CH(2)-CH(2)-undersetunderset(CH(3))(|)(N)-CH(2)-CH(3...

    Text Solution

    |

  7. In the given formula G is an unknown group. What will be the gro...

    Text Solution

    |

  8. The IUPAC name for the following compound is

    Text Solution

    |

  9. Correct IUPAC name of given ester is: CH(3)-undersetunderset(Br)(|)(...

    Text Solution

    |

  10. Relation between Ethyl benzenecarboxylate and phenyl propanoate is:

    Text Solution

    |

  11. The correct IUPAC name of the compound , is:

    Text Solution

    |

  12. Which of the following pair of compounds is not functional isomers?

    Text Solution

    |

  13. A flask contains three times as many moles of H2 gas as it does O2 gas...

    Text Solution

    |

  14. Which of the following pairs of structures do not represent isomers?

    Text Solution

    |

  15. Total number of structural isomers possible from molecular formula C(8...

    Text Solution

    |

  16. Total number of position isomers of trimethyl cyclohexane are:

    Text Solution

    |

  17. How many 1^(@) amines are possible with molecular formula C(4)H(11)N ...

    Text Solution

    |

  18. Hybridisation of carbon atoms present in the smallest ester are:

    Text Solution

    |

  19. The number of metamers of the compound with molecular formula C(5)H(12...

    Text Solution

    |

  20. How many tetriary alcohols of formula C(5)H(12)O are possible ?

    Text Solution

    |