Home
Class 12
CHEMISTRY
How many tetriary alcohols of formula C(...

How many tetriary alcohols of formula `C_(5)H_(12)O` are possible ?

A

1

B

2

C

3

D

4

Text Solution

AI Generated Solution

The correct Answer is:
To determine how many tertiary alcohols of the formula \( C_5H_{12}O \) are possible, we can follow these steps: ### Step 1: Understand the structure of tertiary alcohols A tertiary alcohol is defined as an alcohol in which the hydroxyl group (-OH) is attached to a carbon atom that is bonded to three other carbon atoms. This means that the carbon with the -OH group must be a tertiary carbon. ### Step 2: Analyze the molecular formula The molecular formula given is \( C_5H_{12}O \). We need to ensure that we can create a structure that fits this formula while also satisfying the conditions for a tertiary alcohol. ### Step 3: Calculate the degree of unsaturation The degree of unsaturation can be calculated using the formula: \[ \text{Degree of Unsaturation} = \frac{C + 1 - H + X - N}{2} \] Where: - \( C \) = number of carbons (5) - \( H \) = number of hydrogens (12) - \( X \) = number of halogens (0) - \( N \) = number of nitrogens (0) Substituting the values: \[ \text{Degree of Unsaturation} = \frac{5 + 1 - 12 + 0 - 0}{2} = \frac{-6}{2} = -3 \] Since the degree of unsaturation is 0, this means there are no double bonds, triple bonds, or rings in the structure. ### Step 4: Construct the structure Since we need to create a tertiary alcohol, we can start with a carbon skeleton of 5 carbons. The structure must be such that one of the carbons is attached to the -OH group and is also bonded to three other carbons. A possible structure for a tertiary alcohol with 5 carbons is: - Place the -OH group on a carbon that is connected to three other carbons. ### Step 5: Draw the structure One possible structure is: ``` CH3 | CH3 - C - OH | CH2 - CH3 ``` This structure shows a tertiary carbon (the central carbon) that is bonded to three other carbon groups (two methyl groups and one ethyl group). ### Step 6: Count the possible structures In this case, there is only one way to arrange the five carbons while ensuring that one of them is a tertiary carbon with the -OH group attached. Therefore, there is only **one possible tertiary alcohol** with the formula \( C_5H_{12}O \). ### Final Answer Thus, the number of tertiary alcohols of the formula \( C_5H_{12}O \) is **1**. ---

To determine how many tertiary alcohols of the formula \( C_5H_{12}O \) are possible, we can follow these steps: ### Step 1: Understand the structure of tertiary alcohols A tertiary alcohol is defined as an alcohol in which the hydroxyl group (-OH) is attached to a carbon atom that is bonded to three other carbon atoms. This means that the carbon with the -OH group must be a tertiary carbon. ### Step 2: Analyze the molecular formula The molecular formula given is \( C_5H_{12}O \). We need to ensure that we can create a structure that fits this formula while also satisfying the conditions for a tertiary alcohol. ...
Promotional Banner

Topper's Solved these Questions

  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Advanced Level Problems Part-2 : Practice test-2|21 Videos
  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Advanced Level Problems Part-3|18 Videos
  • IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM

    RESONANCE ENGLISH|Exercise Exercise-3 Part-2|8 Videos
  • IONIC EQUILIBRIUM

    RESONANCE ENGLISH|Exercise partIII one or more than one options correct type|10 Videos
  • METALLURGY

    RESONANCE ENGLISH|Exercise ORGANIC CHEMISTRY(Alkyl Halide, Alcohol,Phenol,Ether)|17 Videos

Similar Questions

Explore conceptually related problems

How many isomeric alcohols with formula C_(4)H_(10)O are possible ?

How many carbonyls of formula C_(5)H_(10)O are possible ?

How many phenols of molecular formula C_(7)H_(8)O are possible ?

How many structural alkenes of formula C_(2)FClBrI are possible:

How many structural isomeric alkane of formula C_(7)H_(16) are possible

How many alcohols with molecular formula C_(4)H_(10)O are chiral in nature ?

How many alcohols with molecular formula C_(4)H_(10)O are chiral in nature ?

Draw the structures of all isomeric alcohols of molecular formula C_(5)H_(12)O and give their IUPAC names

i. Draw the structures of all isomeric alcohols of molecular formula C_(5)H_(12)O and give their IUPAC names. ii. Classify the isomers of alcohols in Q.No.3 (i) as primary, secondary, and tertiary alcohols.

A: The isomeric structural alcohols of molecular formula C_(4)H_(10)O are 4. R: All are primary alcohols.

RESONANCE ENGLISH-IUPAC NOMENCLATURE & STRUCTURAL ISOMERISM -Advanced Level Problems Part-1 : Practice test-1
  1. The IUPAC name of compound CH(3)-C(CH(3))(2)-CH(2)-CH=CH(2) is

    Text Solution

    |

  2. What is the structure of 4-Methylhex-5-en-3-ol.

    Text Solution

    |

  3. A compound having straight chain of five carbon atoms has one ketone g...

    Text Solution

    |

  4. What is the IUPAC name of

    Text Solution

    |

  5. What is the IUPAC name of compound is:

    Text Solution

    |

  6. The IUPAC name of CH(2)-CH(2)-undersetunderset(CH(3))(|)(N)-CH(2)-CH(3...

    Text Solution

    |

  7. In the given formula G is an unknown group. What will be the gro...

    Text Solution

    |

  8. The IUPAC name for the following compound is

    Text Solution

    |

  9. Correct IUPAC name of given ester is: CH(3)-undersetunderset(Br)(|)(...

    Text Solution

    |

  10. Relation between Ethyl benzenecarboxylate and phenyl propanoate is:

    Text Solution

    |

  11. The correct IUPAC name of the compound , is:

    Text Solution

    |

  12. Which of the following pair of compounds is not functional isomers?

    Text Solution

    |

  13. A flask contains three times as many moles of H2 gas as it does O2 gas...

    Text Solution

    |

  14. Which of the following pairs of structures do not represent isomers?

    Text Solution

    |

  15. Total number of structural isomers possible from molecular formula C(8...

    Text Solution

    |

  16. Total number of position isomers of trimethyl cyclohexane are:

    Text Solution

    |

  17. How many 1^(@) amines are possible with molecular formula C(4)H(11)N ...

    Text Solution

    |

  18. Hybridisation of carbon atoms present in the smallest ester are:

    Text Solution

    |

  19. The number of metamers of the compound with molecular formula C(5)H(12...

    Text Solution

    |

  20. How many tetriary alcohols of formula C(5)H(12)O are possible ?

    Text Solution

    |