Home
Class 12
CHEMISTRY
Consider the following silicates (a) B...

Consider the following silicates
(a) `BaTi(Si_(2)O_(9))`
(b) `ZnCa_(2)Si_(2)O_(7)`
Then calculate X+Y, where X and Y are total number of monovalent and divalent oxygen atoms in both silicates respectively.

Text Solution

AI Generated Solution

Promotional Banner

Topper's Solved these Questions

  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise JEE Main Archive|34 Videos
  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise JEE Advanced Archive|48 Videos
  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise LEVEL 1|75 Videos
  • MOCK TEST 9

    VMC MODULES ENGLISH|Exercise CHEMISTRY (SECTION 2)|5 Videos
  • PERIODIC PROPERTIES OF ELEMENTS

    VMC MODULES ENGLISH|Exercise IMPECCABLE|50 Videos

Similar Questions

Explore conceptually related problems

Consider the following silicates (a) BaTi(Si_(3)O_(9)) (b) ZnCa_(2)Si_(2)O_(7) Then calculate X+Y, where X and Y are total number of monovalent and divalent oxygen atoms in both silicates respectively.

Consider the following complexes: (i) [FeIF(CN)(H_(2)O)(en)] (ii) [MoCl_(2)F_(2)(gly)]^(2-) Then, calculate value of |x-y| (where x and y are total number of possible optically active isomers in (i) and (ii) complex respectively).

Consider following four compounds: (i) C_(x) O_(y) (ii) C_(x)O_(y+1) (iii) C_(x+2)O_(y+1) and (iv) C_(x+11)O_(y+8) , if "x=y=1", then calculate the vlaue of |p-q|, where p and q are total number of sp^(2) and hybridized carbon atoms respectively in given four compounds.

Consider the following three compounds (i)AX_(2n)^(n-) , (ii) AX_(3n) and (ii) AX_(4n)^(n+) , where central atom A is 15th group element and their maximum covalency is 3n. If total number of proton in surrounding atom X is n and value of n is one, then calculate value of x^(3)+y^(2)+z^(2) . (where x, y and z are total number of lone pair at central atom in compounds (i), (ii) and (iii) respectively.

Consider the following three compounds (i)AX_(2n)^(n-) , (ii) AX_(3n) and (ii) AX_(4n)^(n+) , where central atom A is 15th group element and their maximum covalency is 3n. If total number of proton in surrounding atom X is n and value of n is one, then calculate value of x^(3)+y^(2)+z^(2) . (where x, y and z are total number of lone pair at central atom in compounds (i), (ii) and (iii) respectively.

Consider the following reaction : xMnO_(4)^(-)+yC_(2)O_(4)^(2-)+zH^(+) to xMn^(2+)+2yCO_(2)+(z)/(2)H_(2)O The value of x, y and z in the reaction are, respectively.

Consider the following reaction, xMnO_(4)^(-)+yC_(2)O_(4)^(2-)+zH^(+)toxMn^(2+)+2yCO_(2)+(z)/(2)H_(2)O The values of x,y and z in the reactions are, respectively

Consider the following reaction x MnO_(4)^(-) + C_(2)O_(4)^(2-) + zH^(+) rarr x Mn^(2+) + 2y CO_(2) + (z)/(2)H_(2)O The value of x, y and z in the reaction are respectively

Consider the following oxyanions: PO_(4)^(3-),P_(2)O_(6)^(4-),SO_(4)^(2-),MnO_(4)^(-),CrO_(4)^(2-),S_(2)O_(5)^(2-),S_(2)O_(7)^(2-) and find the value of R+Q-P where P-number of oxy anions having three equivalent X-O bonds per central atom Q=number of oxy anions having two equivalent X-O bonds per central atom. R=Number of oxy anions having four equivalent X-O bonds per central atom.

What is the value of x in the silicate mineral, Be_(3)Al_(2)Si_(x) O_(18) ?

VMC MODULES ENGLISH-p-BLOCK ELEMENTS-1-LEVEL 2
  1. Consider the structure of Al(2)Me(6) compound and find the value of (x...

    Text Solution

    |

  2. Find the value of x in the tremolite abestos: Ca(2)Mg(x)(Si(4)O(11)...

    Text Solution

    |

  3. Consider the following silicates (a) BaTi(Si(2)O(9)) (b) ZnCa(2)Si...

    Text Solution

    |

  4. Consider Al(2)(OH)(6) compound and calculate the vale of (X+Y):=Z Wh...

    Text Solution

    |

  5. Number of hydroxyl groups present in H(4)P(2)O(6) are :

    Text Solution

    |

  6. Write down the electronic configuration of: ltBrgt (i) Cr^(3+) (ii)...

    Text Solution

    |

  7. Consider the following species: (C(3)H(5))(3)Al Find out total numbe...

    Text Solution

    |

  8. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  9. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  10. Consider the following species and find out total number of species wh...

    Text Solution

    |

  11. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  12. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  13. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  14. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  15. Consider the following species: CF(4),GeH(4),BCl(3),AlBr(3),H(2)O,PH(3...

    Text Solution

    |

  16. In the given reaction the value of x is . B+xHNO(3)toH(3)BO(3)+xNO(2)

    Text Solution

    |

  17. In borazine, the number of delocalized electrons are.

    Text Solution

    |

  18. The number of bridge chlorine in Al(2)Cl(6) is.

    Text Solution

    |

  19. In borax number of sp^(2) hybridised atoms are.

    Text Solution

    |

  20. One mole aluminium carbide reacts with water to given moles of methan...

    Text Solution

    |