Home
Class 12
CHEMISTRY
Consider the following species: CF(4),Ge...

Consider the following species: `CF_(4),GeH_(4),BCl_(3),AlBr_(3),H_(2)O,PH_(3),PCl_(5),CO_(2),CH_(4) and ` calculate value of `(x-y)^(2)`:
Where, x: Total number of species which can act as only lewis acid.
y: total number of species which can act as lewis acid as well as lewis base.

Text Solution

AI Generated Solution

Promotional Banner

Topper's Solved these Questions

  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise JEE Main Archive|34 Videos
  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise JEE Advanced Archive|48 Videos
  • p-BLOCK ELEMENTS-1

    VMC MODULES ENGLISH|Exercise LEVEL 1|75 Videos
  • MOCK TEST 9

    VMC MODULES ENGLISH|Exercise CHEMISTRY (SECTION 2)|5 Videos
  • PERIODIC PROPERTIES OF ELEMENTS

    VMC MODULES ENGLISH|Exercise IMPECCABLE|50 Videos

Similar Questions

Explore conceptually related problems

Consider the following species NO_(3)^(-), SO_(4)^(2-), ClO_(3)^(-),SO_(3), PO_(4)^(3-), XeO_(3),CO_(3)^(2-), SO_(3)^(2-) Then calculate value of |x-y|, where x : Total number of species which have bond order 1.5 or greater than 1.5 y : Total number of species which have bond order less than 1.5

Consider the following species NO_(3)^(-), SO_(4)^(2-), ClO_(3)^(-),SO_(3), PO_(4)^(3-), XeO_(3),CO_(3)^(2-), SO_(3)^(2-) Then calculate value of |x-y|, where x : Total number of species which have bond order 1.5 or greater than 1.5 y : Total number of species which have bond order less than 1.5

Consider the following species: (C_(3)H_(5))_(3)Al Find out total number of species which can act as Lewis acid.

Which of the following species can acts as bronsted base as well as a Lewis base?

Consider the following species: (i) CH_(3)^(+) (ii) (C_(3)H_(5))_(3)Al (iii) HCHO (iv) CH_(4) (v) (C_(2)H_(5))_(3)N (vI) TiCl_(4) (vii) CO_(2) (viii) SiCl_(4) (ix) BF_(3) the find out total number of species which can act as Lewis acid.

Consider the following compounds (1) H_(3)CF (2) H_(2)CF_(2) (3) CH_(4) (4) H_(3)C CF_(3) (5) CH_(3)CH_(3) (6) C_(2)H_(4) and calculate value of Y+X, (where X is the total number of compounds which have H-C-H bond angles equal to 109^(@)28' and Y is the total number of compounds which have H-C-H bond angles greater than 109^(@)28' and less than 120^(@)

Consider the following compounds (1) H_(3)CF (2) H_(2)CF_(2) (3) CH_(4) (4) H_(3)C CF_(3) (5) CH_(3)CH_(2)+ (6) C_(2)H_(4) and calculate value of Y+X, (where X is the total number of compounds which have H-C-H bond angles equal to 109^(@)28' and Y is the total number of compounds which have H-C-H bond angles greater than 109^(@)28' and less than 120^(@)

For the following molecules : PCl_(5), BrF_(3), IC l_(2)^(-), XeF_(5)^(-),NO_(3)^(-),XeO_(2)F_(2),PCl_(4)^(+),CH_(3)^(+) Calculate the value of (a+b)/(c ) a = Number of species having sp^(3) d-hybridisation b= Number of species which are planar c= Number of species which are non-planar

Consider the following orbitals (i) 3p_(x) (ii) 4d_(z^(2)) (iii) 3d_(x^(2)-y^(2)) (iv) 3d_(yz) Then, calculate value of " x+y-z " here x is total number of gerade orbital and y is total number of ungerade orbitals and z is total number of axial orbitals in given above orbitals.

Which of the followings are Lewis acids: H_(2)O, BF_(3), H^(o+) and NH_(4) ?

VMC MODULES ENGLISH-p-BLOCK ELEMENTS-1-LEVEL 2
  1. Consider the structure of Al(2)Me(6) compound and find the value of (x...

    Text Solution

    |

  2. Find the value of x in the tremolite abestos: Ca(2)Mg(x)(Si(4)O(11)...

    Text Solution

    |

  3. Consider the following silicates (a) BaTi(Si(2)O(9)) (b) ZnCa(2)Si...

    Text Solution

    |

  4. Consider Al(2)(OH)(6) compound and calculate the vale of (X+Y):=Z Wh...

    Text Solution

    |

  5. Number of hydroxyl groups present in H(4)P(2)O(6) are :

    Text Solution

    |

  6. Write down the electronic configuration of: ltBrgt (i) Cr^(3+) (ii)...

    Text Solution

    |

  7. Consider the following species: (C(3)H(5))(3)Al Find out total numbe...

    Text Solution

    |

  8. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  9. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  10. Consider the following species and find out total number of species wh...

    Text Solution

    |

  11. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  12. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  13. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  14. Consider the following species: (i) CH(3)^(+) (ii) (C(3)H(5))(3)Al...

    Text Solution

    |

  15. Consider the following species: CF(4),GeH(4),BCl(3),AlBr(3),H(2)O,PH(3...

    Text Solution

    |

  16. In the given reaction the value of x is . B+xHNO(3)toH(3)BO(3)+xNO(2)

    Text Solution

    |

  17. In borazine, the number of delocalized electrons are.

    Text Solution

    |

  18. The number of bridge chlorine in Al(2)Cl(6) is.

    Text Solution

    |

  19. In borax number of sp^(2) hybridised atoms are.

    Text Solution

    |

  20. One mole aluminium carbide reacts with water to given moles of methan...

    Text Solution

    |