IUPAC name of following organic compound `CH_3-overset(O)overset(||)C-underset(OH)underset(|)(CH)-underset(NH_2)underset(|)(CH)-COOH`

Options

A. 2 - amino - 3 - hydroxy - 4 - oxopentanoic acid
B. 4 - amino -3 - hydroxy - 2- oxopentanoic acid
C. 2 - amino - 3- hydroxy - 4- ketopentanoic acid
D. 4 - amino -3 - hydroxy - 2- ketopentanoic acid

Answer

To determine the IUPAC name of the given organic compound, we will follow these steps:

### Step 1: Identify the Structure
The compound is represented as:
```
CH3-C(=O)-C(OH)-C(NH2)-COOH
```
This indicates that we have a chain of carbon atoms with various functional groups attached.

### Step 2: Count the Carbon Atoms
From the structure, we can see that there are a total of 5 carbon atoms. This means the base name will be derived from pentanoic acid since it contains a carboxylic acid (-COOH) functional group.

### Step 3: Determine the Functional Groups
- The compound contains:
- A carboxylic acid (-COOH)
- An amino group (-NH2)
- A hydroxy group (-OH)
- A ketone group (C=O, which will be referred to as oxo in IUPAC naming)

### Step 4: Number the Carbon Chain
We need to number the carbon chain in such a way that the functional groups receive the lowest possible numbers. Starting from the carboxylic acid end:
1. Carboxylic acid (C1)
2. Amino group (C2)
3. Hydroxy group (C3)
4. Ketone group (C4)

### Step 5: Write the Substituent Names with Positions
Now we can write the substituents with their respective positions:
- 2-amino (from C2)
- 3-hydroxy (from C3)
- 4-oxo (from C4)

### Step 6: Combine the Names
Combine the substituents in alphabetical order followed by the base name:
- Alphabetically: amino, hydroxy, oxo
- Therefore, the full name is: **2-amino-3-hydroxy-4-oxopentanoic acid**

### Final Answer
The IUPAC name of the compound is **2-amino-3-hydroxy-4-oxopentanoic acid**.

---