Home
Class 12
CHEMISTRY
In the given reaction CH(2)-CH(2)-over...

In the given reaction
`CH_(2)-CH_(2)-overset(O)overset(||)C-CH_(2)COOC_(2)H_(5)overset([X])rarr (A) overset((i)LiAlH_(4))underset((ii)H_(2)O //H^(o+))rarr CH_(3)-CH_(2)-overset(O)overset(||)C-CH_(2)-CH_(2)OH+C_(2)H_(5)OH`
[X] will be

A

`HCHO`

B

`{:(CH_(2)OH),(|),(CH_(2)OH):},H^(+)`

C

`{:(CH_(2)OH),(|),(CH_(2)OH):},OH^(-)`

D

`HCN`

Text Solution

AI Generated Solution

The correct Answer is:
To solve the given problem, we need to identify the reagent [X] that is used in the reaction to convert the starting compound into compound A, which is then subjected to further reactions with lithium aluminum hydride and dilute acid to yield the final products. ### Step-by-Step Solution: 1. **Analyze the Starting Compound**: The starting compound is `CH2=CH2-C(=O)-CH2-COOC2H5`. This compound contains a carbonyl group (C=O) and an ester functional group (COOC2H5). 2. **Identify the Final Products**: The final products after treatment with lithium aluminum hydride and dilute acid are `CH3-CH2-C(=O)-CH2-CH2OH` and `C2H5OH`. The carbonyl group in the final product remains intact, indicating that it is protected during the reaction. 3. **Understand the Role of [X]**: Since the carbonyl group must remain unchanged while the ester is converted to alcohols, we need a reagent that can protect the carbonyl group. 4. **Choose the Protecting Group**: A common method for protecting carbonyl groups is to use ethylene glycol in an acidic medium. This forms a cyclic acetal or a similar structure that protects the carbonyl group from reduction. 5. **Write the Reaction with [X]**: The reaction with ethylene glycol (HO-CH2-CH2-OH) in an acid medium will protect the carbonyl group. The reaction can be represented as: \[ CH2=CH2-C(=O)-CH2-COOC2H5 + HO-CH2-CH2-OH \xrightarrow{H^+} \text{Protected Carbonyl} \] 6. **Reduction with Lithium Aluminum Hydride**: After protection, the compound is treated with lithium aluminum hydride (LiAlH4), which reduces the ester to two alcohols, while the carbonyl remains protected. 7. **Acid Workup**: Finally, the protected carbonyl group is removed by hydrolysis with dilute acid, yielding the final products. 8. **Conclusion**: Therefore, the reagent [X] that protects the carbonyl group during the reaction is ethylene glycol in an acid medium. ### Final Answer: The reagent [X] is **ethylene glycol in acidic medium**.
Promotional Banner

Similar Questions

Explore conceptually related problems

In the given reaction CH_(3)-overset(O)overset(||)(C)-C_(2)H_(5)overset(X)rarrCH_(3)-CH_(2)-C_(2)H_(5) 'X' will be

In the given reaction : C_(2)H_(5)O-overset(O)overset(||)C-(CH_(2))_(3)-CH_(2)-COOC_(2)H_(5)underset((ii)H_(2)O //HCl)overset((i)C_(2)H_(5)ONa//C_(2)H_(5)OH)rarr[X] [X] is :

CH_(3)CH_(2)-overset(O)overset(||)C-O-C_(2)H_(2)overset((i)DIBAL.H(1 eq))underset((ii)H_(3)O^(+)) to A+B A and B are respectively.

End product of this conversion CH_(3)-overset(O)overset(||)(C)-CH_(2)-CH_(2)-CH_(2)-CO_(2)H overset(1. NaBH_(4))underset(2.H_(2)O,H^(+))to is

CH_(3)OH+C_(2)H_(5)OH overset(H^(o+))rarr Products

In the given reaction C_6H_5-overset(O)overset(||)C-CH_3overset((i)C_2H_8MgBr)underset((ii)H_2"O"//H^+)rarr(X) X will be

Find the last product [D] in reaction sequence C_(6)H_(5)CHO+CH_(3)-overset(O)overset(||)C-CH_(2)-COOC_(2)H_(5) overset(H_3O^(+))to A overset(Delta)to C underset(OH^(-)//Delta) overset(NH_2-NH_2)to D