The IUPAC name of the given structure `CH_(3)-overset(O)overset(||)C-overset(Br)overset(|)CH-underset(I)underset(|)CH-COOH` is-

Options

A. 4 - keto -3- bromo -2- iodopentanoic acid
B. 2 - iodo -3- bromo -4- keto - pentanoic acid
C. 3 - bromo -2- iodo -4- ketopentanoic acid
D. 4 - carboxy -3- bromo -4- iodopentanoic acid

Answer

To derive the IUPAC name of the given structure `CH3-CO-C(Br)-C(I)-CH-COOH`, we will follow these steps:

### Step 1: Identify the main functional group
The main functional group in the structure is the carboxylic acid group (-COOH). According to IUPAC nomenclature, carboxylic acids take precedence over other functional groups.

### Step 2: Determine the longest carbon chain
Count the number of carbon atoms in the longest continuous chain that includes the carboxylic acid group. In this case, there are 5 carbon atoms in total.

### Step 3: Number the carbon chain
Number the carbon chain starting from the end nearest to the carboxylic acid group. This gives the following numbering:
- Carbon 1: COOH (carboxylic acid)
- Carbon 2: Iodine substituent (I)
- Carbon 3: Bromo substituent (Br)
- Carbon 4: Ketone group (C=O)
- Carbon 5: Methyl group (CH3)

### Step 4: Identify substituents and their positions
- At Carbon 2, there is an iodine atom (Iodo).
- At Carbon 3, there is a bromine atom (Bromo).
- At Carbon 4, there is a ketone group (Keto).

### Step 5: Assemble the name
According to IUPAC rules, substituents are listed in alphabetical order regardless of their position numbers. Therefore, we will list the substituents as follows:
- Bromo (from Carbon 3)
- Iodo (from Carbon 2)
- Keto (from Carbon 4)

### Step 6: Combine substituents with the main chain name
The base name for a 5-carbon chain is "pentane." Since the main functional group is a carboxylic acid, we will use the suffix "-oic acid." Thus, the base name becomes "pentanoic acid."

### Step 7: Finalize the IUPAC name
Putting it all together, the full IUPAC name is:
**3-Bromo-2-Iodo-4-ketopentanoic acid**

### Final Answer
The IUPAC name of the given structure is **3-Bromo-2-Iodo-4-ketopentanoic acid**.