Home
Class 11
CHEMISTRY
NH(4)HS(s)hArrNH(3)(g)+H(2)S(g) The eq...

`NH_(4)HS(s)hArrNH_(3)(g)+H_(2)S(g)`
The equilibrium pressure at `25^(@)C` is 0.660 atm . What is `K_(p)` for the reaction?

A

0.109

B

`0.218`

C

`1.89`

D

`2.18`

Text Solution

Verified by Experts

The correct Answer is:
a
Promotional Banner

Topper's Solved these Questions

  • CHEMICAL EQUILIBRIUM

    NARENDRA AWASTHI|Exercise Level 1 (Q.93 To Q.122)|1 Videos

  • CHEMICAL EQUILIBRIUM

    NARENDRA AWASTHI|Exercise Level 2|1 Videos

  • ATOMIC STUCTURE

    NARENDRA AWASTHI|Exercise level 2|1 Videos

  • DILUTE SOLUTION

    NARENDRA AWASTHI|Exercise Level 3 - Match The Column|1 Videos

Similar Questions

Explore conceptually related problems

A definite amount of solid NH_(4)HS is placed in a flask already containing ammonia gas at a certain temperature and 0.1 atm pressure. NH_(4)HS decompses to give NH_(3) and H_(2)S and at equilibrium total pressure in flask is 1.1 atm. If the equilibrium constant K_(P) for the reaction NH_(4)HS(s) iff NH_(3)(g)+H_(2)S(g) is represented as zxx10^(-1) then find the value of z.

A sample of HI (g) is placed in a flask at a pressure of 0.2 atm. At equilibrium the partial pressure of HI (g) is 0.04 atm. What is K_(p) for the given equilibrium ? 2HI(g) hArr H_(2)(g) + I_(2)(g)

At 1000 K , a sample of pure NO_(2) gases decomposes as : 2NO_(2)(g)hArr2NO(g)+O_(2)(g) The equilibrium constant K_(P) is 156.25 atm .Analysis showns that the partial pressure of O_(2) is 0.25 atm at equilibrium .The parital pressure o f NO_(2) at equilibrium is :

For the reaction 2NO_(2)(g)+(1)/(2)O_(2)(g)hArrN_(2)O_(5)(g) if the equilibrium constant is K_(p) , then the equilibrium constant for the reaction 2N_(2)O_(5)(g)hArr4NO_(2)(g)+O_(2)(g) would be :

At a certain temperature , the following reactions have the equilibrium constants as shown below: S(s)+O_(2)(g)hArrSO_(2)(g),K_(c)=5xx10^(52) 2S(s)+3O_(2)(g)hArr2SO_(3)(g),K_(c)=10^(29) what is the equilibrium constant K_(c) for the reaction at the same temperature? 2SO_(2)(g)+O_(2)(g)hArr2SO_(3)(g)

In the presence of excess of anhydrous ( in torr) of water taken up is governed by K_(p)=10^(12)atm^(-4) for the following reaction at 273K SrCl_(2).2H_(2)O(s)+4H_(2)O(g)hArrSrCl_(2).6H_(2)O(s) What is equilibrium vapour pressure ( in torr) of water in a closedvessel that contains SrCl_(2).2H_(2)O(s) ?

Solid Ca(HCO_(3))_(2) decomposes as Ca(HCO_(3))_(2)(s)hArrCaCO_(3)(s)+CO_(2)(g)+H_(2)O(g) If the total pressure is 0.2 bat at 420 K, what is the standard free energy change for the given reaction (Delta_(r)G^(@)) ?

The equilibrium constant (K_(c)) for the reaction 2HCl(g)hArrH_(2)(g)+CL_(2)(g) is 4xx10^(-34) at 25^(@)C .what is the equilibrium constant for the reaction ? (1)/(2)H_(2)(g)+(1)/(2)Cl_(2)(g)hArrHCl(g)

N_(2)(g) and H_(2)(g) are allowed to react in a closed vessel at given temp. and pressure for the formation of NH_(3)(g),[N_(2)(g)+3H_(2)(g)hArr2NH_(3)(g)+22.4kcal] If he (g) is added at equilibrium at constant pressure than which is/are correct ?

In the reaction C(s)+CO_(2)(g) hArr 2CO(g) , the equilibrium pressure is 12 atm. If 50% of CO_(2) reacts, calculate K_(p) .