To solve the question, we need to analyze both the assertion and the reason provided.
### Step-by-Step Solution:
1. **Understanding the Compound**:
- The compound in question is 2,4-Dimethylhex-2-ene. This indicates that we have a hexane chain (6 carbon atoms) with a double bond at the second carbon and two methyl groups at the second and fourth positions.
2. **Drawing the Structure**:
- The structure of 2,4-Dimethylhex-2-ene can be drawn as follows:
```
CH3-CH=C(CH3)-CH2-CH(CH3)-CH3
```
- This shows that at carbon 2, we have a double bond and a methyl group, and at carbon 4, we have another methyl group.
3. **Identifying Chiral Centers**:
- A chiral carbon is defined as a carbon atom that is attached to four different groups.
- In the structure, we need to check each carbon:
- Carbon 2 (C=C) is not chiral because it has two identical methyl groups attached.
- Carbon 4 is also not chiral because it has two identical groups (the two methyl groups).
- The only potential chiral center is at carbon 3, which is attached to four different groups (CH3, CH2, H, and the rest of the carbon chain).
- Therefore, there is **1 chiral center** in 2,4-Dimethylhex-2-ene.
4. **Calculating Stereoisomers**:
- The formula for calculating the number of stereoisomers is \(2^n\), where \(n\) is the number of chiral centers.
- Since we have 1 chiral center (\(n = 1\)), the number of stereoisomers is:
\[
2^1 = 2
\]
- Thus, the assertion that 2,4-Dimethylhex-2-ene has 4 stereoisomers is **false**.
5. **Analyzing Geometrical Isomerism**:
- Geometrical isomerism occurs in compounds with a double bond where there are different groups attached to the carbons of the double bond.
- In this case, the double bond is between carbon 2 and carbon 3. However, both groups attached to carbon 2 are identical (two methyl groups).
- Therefore, this compound does not exhibit geometrical isomerism, making the reason **false** as well.
6. **Conclusion**:
- Both the assertion and the reason are false. Therefore, the correct answer is that both the assertion and reason are false.
### Final Answer:
Both assertion and reason are false.
---