Home
Class 11
CHEMISTRY
The body temperature of a normal heatlhy...

The body temperature of a normal heatlhy person is `98.4^@` F.Write the temperature on the celsius scale?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos
  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Convert the following temperature to the Celsius scale. 470 K

Convert the following temperature to the celsium scale. 293 K

Convert the following temperature to Celsius scale. 300 K

Convert the following temperature to Celsius scale. 573 K

At Sringar temperature was -5^@C on Monday and then it dropped by 2^@C on Tuesday. What was the temperature of Srinagar on Tuesday? ON Wednesday it rose by 4^@C. What was the temperature on this day.

In countries like USA and Canada, temperature is measured in fahrenheit, whereas in countries like India, it is measured in celsius. Here is a linear equation that converts fahrenheit to celsius. F=(9/5)C+32 . If the temperature if 0^(@)C , what is the temperature in fahrenheit and if the temperature is 0^(@)F , what is the temperature in celsius?

Convert the following temperature to the Celsius scale (a) 293K (b) 470K

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. The body temperature of a normal heatlhy person is 98.4^@ F.Write the ...

    Text Solution

    |

  2. Define vapour pressure.

    Text Solution

    |

  3. How are K(p)andK(c) related? Mention the condition under which K(p)=K(...

    Text Solution

    |

  4. Name the element which is most electronegative , and the element which...

    Text Solution

    |

  5. What do you mean by disproportionation reaction?

    Text Solution

    |

  6. why do alkali metals give characteristic flame colouration?

    Text Solution

    |

  7. How does BF(3) act as a catalyst in industrial processes ?

    Text Solution

    |

  8. What is the hybridisation state of C in diamond?

    Text Solution

    |

  9. Which type of organic compounds cannot be Kjeldahilsed?

    Text Solution

    |

  10. What is conformation in alkanes

    Text Solution

    |

  11. Explain the law of reciprocal proportions with suitable example.

    Text Solution

    |

  12. State Boyle's law.

    Text Solution

    |

  13. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  14. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  15. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  16. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  17. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  18. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  19. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  20. Explain peroxide effect with suitable example.

    Text Solution

    |