Home
Class 11
CHEMISTRY
How are K(p)andK(c) related? Mention the...

How are `K_(p)andK_(c)` related? Mention the condition under which `K_(p)=K_(c)`.

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Write an example for the reaction in which K_(p)=K_(c)

Write the relationship between K_(p)andK_(c) .

Give an example for a reversible reaction in which K_(p)=K_(c)RT .

Give an example of a reaction where K_(p)neK_(c) .

Give an example of reaction where K_p=K_c

Relate K_(p) and K_(c) when Deltan=0, Deltan=1, Deltan=2

What is the relationship between pK_(a)andpK_(b) values where K_(a)andK_(b) represent ionization constants of the acid and its conjugate base respectively?

Write the expressions for K_(c)andK_(p) for the reaction, 2A+3Bunderset(V_(b))overset(V_(f))(hArr)4C+5D

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. The body temperature of a normal heatlhy person is 98.4^@ F.Write the ...

    Text Solution

    |

  2. Define vapour pressure.

    Text Solution

    |

  3. How are K(p)andK(c) related? Mention the condition under which K(p)=K(...

    Text Solution

    |

  4. Name the element which is most electronegative , and the element which...

    Text Solution

    |

  5. What do you mean by disproportionation reaction?

    Text Solution

    |

  6. why do alkali metals give characteristic flame colouration?

    Text Solution

    |

  7. How does BF(3) act as a catalyst in industrial processes ?

    Text Solution

    |

  8. What is the hybridisation state of C in diamond?

    Text Solution

    |

  9. Which type of organic compounds cannot be Kjeldahilsed?

    Text Solution

    |

  10. What is conformation in alkanes

    Text Solution

    |

  11. Explain the law of reciprocal proportions with suitable example.

    Text Solution

    |

  12. State Boyle's law.

    Text Solution

    |

  13. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  14. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  15. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  16. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  17. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  18. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  19. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  20. Explain peroxide effect with suitable example.

    Text Solution

    |