Home
Class 11
CHEMISTRY
What do you mean by disproportionation r...

What do you mean by disproportionation reaction?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Identify disproportionation reaction :

What do you mean by crop rotation?

What do you mean by a precipitation reaction ? Explain by giving examples.

What do you mean by hydrophily?

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. How are K(p)andK(c) related? Mention the condition under which K(p)=K(...

    Text Solution

    |

  2. Name the element which is most electronegative , and the element which...

    Text Solution

    |

  3. What do you mean by disproportionation reaction?

    Text Solution

    |

  4. why do alkali metals give characteristic flame colouration?

    Text Solution

    |

  5. How does BF(3) act as a catalyst in industrial processes ?

    Text Solution

    |

  6. What is the hybridisation state of C in diamond?

    Text Solution

    |

  7. Which type of organic compounds cannot be Kjeldahilsed?

    Text Solution

    |

  8. What is conformation in alkanes

    Text Solution

    |

  9. Explain the law of reciprocal proportions with suitable example.

    Text Solution

    |

  10. State Boyle's law.

    Text Solution

    |

  11. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  12. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  13. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  14. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  15. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  16. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  17. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  18. Explain peroxide effect with suitable example.

    Text Solution

    |

  19. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  20. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |