Home
Class 11
CHEMISTRY
How does BF(3) act as a catalyst in indu...

How does `BF_(3)` act as a catalyst in industrial processes ?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Why does BCL_3 acts as lewis acid?

Which one of the following also acts as a catalyst in a bacterial cell ?

Why does NH_(3) act as a Lewis base?

Why does BF_(3) behaves as Lewis acid?

Why does O_(3) act as a powerful oxidizing agent?

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. What do you mean by disproportionation reaction?

    Text Solution

    |

  2. why do alkali metals give characteristic flame colouration?

    Text Solution

    |

  3. How does BF(3) act as a catalyst in industrial processes ?

    Text Solution

    |

  4. What is the hybridisation state of C in diamond?

    Text Solution

    |

  5. Which type of organic compounds cannot be Kjeldahilsed?

    Text Solution

    |

  6. What is conformation in alkanes

    Text Solution

    |

  7. Explain the law of reciprocal proportions with suitable example.

    Text Solution

    |

  8. State Boyle's law.

    Text Solution

    |

  9. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  10. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  11. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  12. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  13. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  14. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  15. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  16. Explain peroxide effect with suitable example.

    Text Solution

    |

  17. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  18. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  19. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  20. Define the terms: Octet Rule

    Text Solution

    |