Home
Class 11
CHEMISTRY
Explain the law of reciprocal proportion...

Explain the law of reciprocal proportions with suitable example.

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Explain law of constant composition with suitable example.

Explain law of multiple proportions with example:

Define ferrimagnetism with suitable examples.

Aluminium oxide contains 52.9% aluminium and carbon dioxide contains 27.27% carbon. Assuming the law of reciprocal proportions, calculalte the percentage of aluminium in aluminium carbide.

Explain law of octaves.

Explain the enthalpy of hydration with suitable example.

State Law of definite proportions.

Explain the law of independent assortment with a classical example.

Explain saponifiactiion of oils with a suitable example.

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. Which type of organic compounds cannot be Kjeldahilsed?

    Text Solution

    |

  2. What is conformation in alkanes

    Text Solution

    |

  3. Explain the law of reciprocal proportions with suitable example.

    Text Solution

    |

  4. State Boyle's law.

    Text Solution

    |

  5. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  6. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  7. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  8. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  9. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  10. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  11. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  12. Explain peroxide effect with suitable example.

    Text Solution

    |

  13. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  14. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  15. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  16. Define the terms: Octet Rule

    Text Solution

    |

  17. Define the terms, Bond length

    Text Solution

    |

  18. Define the terms : Formal charge.

    Text Solution

    |

  19. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  20. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |