Home
Class 11
CHEMISTRY
Give two difference between bonding mole...

Give two difference between bonding molecular orbital and antibonding molecular orbital.

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Give two differences between order and molecularity of a reaction.

Give four differences between order and molecularity of a reaction.

How are anti-bonding molecular orbitals formed ?

Give any two difference between sigmaandpi bond.

Give two differences between a zygote and a foetus.

Give two difference between starch and cellulose.

Write any two differences between order and molecularity of reaction .

Give two differences between Amylose and Amylopectin.

Write any two differences between order and molecularity of a reaction?

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. State Boyle's law.

    Text Solution

    |

  2. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  3. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  4. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  5. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  6. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  7. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  8. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  9. Explain peroxide effect with suitable example.

    Text Solution

    |

  10. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  11. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  12. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  13. Define the terms: Octet Rule

    Text Solution

    |

  14. Define the terms, Bond length

    Text Solution

    |

  15. Define the terms : Formal charge.

    Text Solution

    |

  16. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  17. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  18. Define intermolecular hydrogen bonding.

    Text Solution

    |

  19. Draw the energy level daigram of N2 . calculate its bond order.

    Text Solution

    |

  20. How does H2O2 behave as a bleachihing agent?

    Text Solution

    |