Home
Class 11
CHEMISTRY
What happens when sodium carbonate under...

What happens when sodium carbonate undergoes hydolysis? Give chemical reaction takes place

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

What happens when sodium carbonate undergoes hydrolysis?

What happens when propene undergoes ozonolysis?

What happens when sodium metal is dropped in water?

When benzene diazonium chloride undergoes hydrolysis, it gives

What happens when sodium metal is heated in air?Give equation.

How does chemical coordination takes place in animals ?

How does chemical coordination take place in animals?

What happens when the carbonly compounds are treated with hydrazine? Write the reaction.

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. Write an equation for root mean square velocity of a gas.

    Text Solution

    |

  2. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  3. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  4. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  5. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  6. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  7. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  8. Explain peroxide effect with suitable example.

    Text Solution

    |

  9. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  10. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  11. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  12. Define the terms: Octet Rule

    Text Solution

    |

  13. Define the terms, Bond length

    Text Solution

    |

  14. Define the terms : Formal charge.

    Text Solution

    |

  15. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  16. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  17. Define intermolecular hydrogen bonding.

    Text Solution

    |

  18. Draw the energy level daigram of N2 . calculate its bond order.

    Text Solution

    |

  19. How does H2O2 behave as a bleachihing agent?

    Text Solution

    |

  20. Write any two similarities between Lithium and Magnesium.

    Text Solution

    |