Home
Class 11
CHEMISTRY
What happens when CO2 is passed through ...

What happens when `CO_2` is passed through lime water : For a short duration

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos
  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

What happens when CO_(2) is passed through lime water (i) for a short duration (ii) for a long duration ?

What happens when CO_2 is passed through lime water : For a long duration?

What is observed when carbondioxide gas is passed through lime water For a short duration ?

What is observed when carbon dioxide gas is passed through lime water. (i) For a short duration (ii) For long durration ? Also write the chemical equations for the reaction involved.

Tell me What happens when carbon dioxide gas is passed through lime water and why does it disappear on passing excess carbon dioxide?

What is observed when carbondioxide gas is passed through lime water For a long duration ? Write the chemical equation.

What happens when acetylene is passed through red-hot tube?

(i) Solid calcium oxide was taken in a container and water was added slowly to it : (a) Write the observation . (b) Write the chemical formula of the product formed (ii) What happens when carbon dioxide gas is bubbled through lime water : (a) In small amount , (b) In excess? (iii) Why do you apply paint on iron articles ?

What happens when anisole is nitrated ?

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. Give two difference between bonding molecular orbital and antibonding ...

    Text Solution

    |

  2. What happens when sodium carbonate undergoes hydolysis? Give chemical ...

    Text Solution

    |

  3. What happens when CO2 is passed through lime water : For a short durat...

    Text Solution

    |

  4. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  5. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  6. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  7. Explain peroxide effect with suitable example.

    Text Solution

    |

  8. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  9. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  10. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  11. Define the terms: Octet Rule

    Text Solution

    |

  12. Define the terms, Bond length

    Text Solution

    |

  13. Define the terms : Formal charge.

    Text Solution

    |

  14. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  15. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  16. Define intermolecular hydrogen bonding.

    Text Solution

    |

  17. Draw the energy level daigram of N2 . calculate its bond order.

    Text Solution

    |

  18. How does H2O2 behave as a bleachihing agent?

    Text Solution

    |

  19. Write any two similarities between Lithium and Magnesium.

    Text Solution

    |

  20. What happens when CaO is heated with ammonium chloride?

    Text Solution

    |