Home
Class 11
CHEMISTRY
Write the IUPAC name of following organi...

Write the IUPAC name of following organic compounds:

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos
  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Write IUPAC name of the following organic compounds:

Write IUPAC name of the following organic compounds:

write IUPAC name of the following organic compounds: CH_3-CH=CH-CH_3

write IUPAC name of the following organic compounds:

write IUPAC name of the following organic compounds:

Write IUPAC name of the following:

Write the IUPAC name of the following compounds.

Write the IUPAC name of the following compound :

Give the IUPAC name of the following compounds

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. What happens when CO2 is passed through lime water : For a long durati...

    Text Solution

    |

  2. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  3. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  4. Explain peroxide effect with suitable example.

    Text Solution

    |

  5. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  6. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  7. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  8. Define the terms: Octet Rule

    Text Solution

    |

  9. Define the terms, Bond length

    Text Solution

    |

  10. Define the terms : Formal charge.

    Text Solution

    |

  11. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  12. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  13. Define intermolecular hydrogen bonding.

    Text Solution

    |

  14. Draw the energy level daigram of N2 . calculate its bond order.

    Text Solution

    |

  15. How does H2O2 behave as a bleachihing agent?

    Text Solution

    |

  16. Write any two similarities between Lithium and Magnesium.

    Text Solution

    |

  17. What happens when CaO is heated with ammonium chloride?

    Text Solution

    |

  18. Give suitable reason or equation for the following statements : Silico...

    Text Solution

    |

  19. Give suitable reaction or equation for the following statements : C is...

    Text Solution

    |

  20. Give suitable reason or equation for the following statements : Alumin...

    Text Solution

    |