Home
Class 11
CHEMISTRY
Explain peroxide effect with suitable ex...

Explain peroxide effect with suitable example.

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 6

    OSWAAL PUBLICATION|Exercise Exercise|64 Videos

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

Similar Questions

Explore conceptually related problems

Explain inert pair effect with suitable example.

Define alloys. List the properties of alloys that make them useful over pure metals ? Explain this fact with suitable examples.

State Mendel's law of segregation. Explain it with a suitable example.

Explain the following terms with suitable examples : Ferromagnetism and Ferrimagnetism.

What is hybrid vehicle technology ? Explain the advantages with a suitable example ?

Explain the following terms with suitable examples : (i) Cationic detergents (ii) Anionic detergents.

Explain the following terms with suitable examples (i) Alcosol, (ii) Aerosol and (iii) Hydrosol.

The rate of appearance of new forms is linked to the life span of an organism. Explain with the help of a suitable example.

Define ferrimagnetism with suitable examples.

OSWAAL PUBLICATION-Sample Paper 7-Exercise
  1. Write the IUPAC name of following organic compounds:(CH3)3-C-CH=CH2

    Text Solution

    |

  2. Write the IUPAC name of following organic compounds:

    Text Solution

    |

  3. Explain peroxide effect with suitable example.

    Text Solution

    |

  4. What do you mean by Biological Oxygen Demand (BOD) ? Give the BOD valu...

    Text Solution

    |

  5. Why is melting point of LiCl lower than NaCl ?

    Text Solution

    |

  6. Give the name and atomic number of the noble gas element in which the ...

    Text Solution

    |

  7. Define the terms: Octet Rule

    Text Solution

    |

  8. Define the terms, Bond length

    Text Solution

    |

  9. Define the terms : Formal charge.

    Text Solution

    |

  10. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  11. Which hybrid orbitals are used by carbon atoms in the following molecu...

    Text Solution

    |

  12. Define intermolecular hydrogen bonding.

    Text Solution

    |

  13. Draw the energy level daigram of N2 . calculate its bond order.

    Text Solution

    |

  14. How does H2O2 behave as a bleachihing agent?

    Text Solution

    |

  15. Write any two similarities between Lithium and Magnesium.

    Text Solution

    |

  16. What happens when CaO is heated with ammonium chloride?

    Text Solution

    |

  17. Give suitable reason or equation for the following statements : Silico...

    Text Solution

    |

  18. Give suitable reaction or equation for the following statements : C is...

    Text Solution

    |

  19. Give suitable reason or equation for the following statements : Alumin...

    Text Solution

    |

  20. Explain heterogenous mixtures Give one example

    Text Solution

    |