Home
Class 11
CHEMISTRY
Among the molarity and molality,Which on...

Among the molarity and molality,Which one is temperature dependent?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

  • Solved Paper 2017-1

    OSWAAL PUBLICATION|Exercise EXERCISE|56 Videos

Similar Questions

Explore conceptually related problems

Define molarity and molality.

How does molarity varies with temperature ?

How does molarity varies with temperature?

Among alcohols and phenols which one is more acidic?

Differentiate between molarity and molality in a solution. What is the effect of temperature change on molarity and molality in a solution ?

Among the following compounds, which one will be dehydrated very easily :

Write the energy distribution curve showing temperature dependence of rate of a reaction.

The density of 5% aqueous MgCl_(2) solution is 1.043 g mL^(-1) . What is the molarity and molaltiy of the solution? What is the molality of Cl^(ɵ) ions? (Mg = 24 "amu")

OSWAAL PUBLICATION-Solved Paper 2016-1-EXCERSICE
  1. Among the molarity and molality,Which one is temperature dependent?

    Text Solution

    |

  2. What is an ideal gas?

    Text Solution

    |

  3. Write an example for the reaction in which K(p)=K(c)

    Text Solution

    |

  4. Give reason.the radius of anion is always greater than neutral atom.

    Text Solution

    |

  5. What is the colour of the flame when sodium is subjected to flame test...

    Text Solution

    |

  6. Write the general electronic configuration of p-block elements.

    Text Solution

    |

  7. Why does BCL3 acts as lewis acid?

    Text Solution

    |

  8. Write the IUPAC name of CH3-C(OH3)2-CH2-CH(CH3)CH-3

    Text Solution

    |

  9. What is the product obtained when alkynes are subjected to hydrogenati...

    Text Solution

    |

  10. Classify the following into pure substance and mixture. Copper(s), HC...

    Text Solution

    |

  11. Calculate the volume occupied by 8.8 g of CO(2) at 31.1^(@)C and 1 bar...

    Text Solution

    |

  12. Give any two difference between sigmaandpi bond.

    Text Solution

    |

  13. What is called diagonal relationship ?

    Text Solution

    |

  14. In goup 14, the tendency of the elements to show +4 oxidation state de...

    Text Solution

    |

  15. Alkyhalide (halo alkane)+sodium.Complete the chemical equation and nam...

    Text Solution

    |

  16. Explain the mechanism of addition of hydrogen bromide to propene.

    Text Solution

    |

  17. What is greenhouse effect?Name any one gas which is responsible for t...

    Text Solution

    |

  18. Give three defects of mendeleev's periodic table.

    Text Solution

    |

  19. Write the electronic configuration of Hydrogen molecule. Calculate its...

    Text Solution

    |

  20. What is sp^2 hybridisation?Illustrate the formation of Ionic bond.

    Text Solution

    |