Write an example for the reaction in whi...

Write an example for the reaction in which `K_(p)=K_(c)`

Topper's Solved these Questions

Sample Paper 8
OSWAAL PUBLICATION|Exercise Exercise|62 Videos
Solved Paper 2017-1
OSWAAL PUBLICATION|Exercise EXERCISE|56 Videos

Similar Questions

Explore conceptually related problems

Give an example for a reversible reaction in which K_(p)=K_(c)RT .

Give an example of a reaction where K_(p)neK_(c) .

Give one example for the relation between K_(p)andK_(c) for a reaction, if Deltan = 0.

Give an example of reaction where K_p=K_c

How are K_(p)andK_(c) related? Mention the condition under which K_(p)=K_(c) .

Write the relationship between K_(p)andK_(c) .

Write the expression of K_(c) for the reaction N_(2)(g)+3H_(2)(g)hArr2NH_(3)(g) . Give units of K.

Write the expression of K_(p) for the reaction. N_(2)O(g)hArr2NO_(2)(g)

The equilibrium constant expressioni for as gas reaction is K_(c)=([NH_(3)]^(4)[O_(2)]^(5))/([NO]^(4)[H_(2)O]^(6)) . Write the balanced chemical equation corresponding to this expression.

OSWAAL PUBLICATION-Solved Paper 2016-1-EXCERSICE

Among the molarity and molality,Which one is temperature dependent?
Text Solution
|
What is an ideal gas?
Text Solution
|
Write an example for the reaction in which K(p)=K(c)
Text Solution
|
Give reason.the radius of anion is always greater than neutral atom.
Text Solution
|
What is the colour of the flame when sodium is subjected to flame test...
Text Solution
|
Write the general electronic configuration of p-block elements.
Text Solution
|
Why does BCL3 acts as lewis acid?
Text Solution
|
Write the IUPAC name of CH3-C(OH3)2-CH2-CH(CH3)CH-3
Text Solution
|
What is the product obtained when alkynes are subjected to hydrogenati...
Text Solution
|
Classify the following into pure substance and mixture. Copper(s), HC...
Text Solution
|
Calculate the volume occupied by 8.8 g of CO(2) at 31.1^(@)C and 1 bar...
Text Solution
|
Give any two difference between sigmaandpi bond.
Text Solution
|
What is called diagonal relationship ?
Text Solution
|
In goup 14, the tendency of the elements to show +4 oxidation state de...
Text Solution
|
Alkyhalide (halo alkane)+sodium.Complete the chemical equation and nam...
Text Solution
|
Explain the mechanism of addition of hydrogen bromide to propene.
Text Solution
|
What is greenhouse effect?Name any one gas which is responsible for t...
Text Solution
|
Give three defects of mendeleev's periodic table.
Text Solution
|
Write the electronic configuration of Hydrogen molecule. Calculate its...
Text Solution
|
What is sp^2 hybridisation?Illustrate the formation of Ionic bond.
Text Solution
|