Home
Class 11
CHEMISTRY
Give reason.the radius of anion is alway...

Give reason.the radius of anion is always greater than neutral atom.

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

  • Solved Paper 2017-1

    OSWAAL PUBLICATION|Exercise EXERCISE|56 Videos

Similar Questions

Explore conceptually related problems

Define the term ionic radius. Justify that the radius of anion is larger than the parent atom.

Explain why size of anion is larger than parent atom.

Write 5 rational numbers greater than -2.

The ratio of cationic radius to anionic radius in an ionic crystal is greater than 0.732. its coordination number is

Give an example for a neutral complex.

In a binomial distribution B( n , p =1/4) , if the probability of at least one success is greater than or equal to 9/10 , then n is greater than :

Give reason: Why Lanthanoids are less reactive than actinoids.

The emf of a cell is always greater than its terminal voltage. Why? Give reason.

Which of the following sentences are statements? Give reasons for your answer The sum of 5 and 7 is greater than 10.

OSWAAL PUBLICATION-Solved Paper 2016-1-EXCERSICE
  1. What is an ideal gas?

    Text Solution

    |

  2. Write an example for the reaction in which K(p)=K(c)

    Text Solution

    |

  3. Give reason.the radius of anion is always greater than neutral atom.

    Text Solution

    |

  4. What is the colour of the flame when sodium is subjected to flame test...

    Text Solution

    |

  5. Write the general electronic configuration of p-block elements.

    Text Solution

    |

  6. Why does BCL3 acts as lewis acid?

    Text Solution

    |

  7. Write the IUPAC name of CH3-C(OH3)2-CH2-CH(CH3)CH-3

    Text Solution

    |

  8. What is the product obtained when alkynes are subjected to hydrogenati...

    Text Solution

    |

  9. Classify the following into pure substance and mixture. Copper(s), HC...

    Text Solution

    |

  10. Calculate the volume occupied by 8.8 g of CO(2) at 31.1^(@)C and 1 bar...

    Text Solution

    |

  11. Give any two difference between sigmaandpi bond.

    Text Solution

    |

  12. What is called diagonal relationship ?

    Text Solution

    |

  13. In goup 14, the tendency of the elements to show +4 oxidation state de...

    Text Solution

    |

  14. Alkyhalide (halo alkane)+sodium.Complete the chemical equation and nam...

    Text Solution

    |

  15. Explain the mechanism of addition of hydrogen bromide to propene.

    Text Solution

    |

  16. What is greenhouse effect?Name any one gas which is responsible for t...

    Text Solution

    |

  17. Give three defects of mendeleev's periodic table.

    Text Solution

    |

  18. Write the electronic configuration of Hydrogen molecule. Calculate its...

    Text Solution

    |

  19. What is sp^2 hybridisation?Illustrate the formation of Ionic bond.

    Text Solution

    |

  20. Define dipole moment.

    Text Solution

    |