Home
Class 11
CHEMISTRY
What is the colour of the flame when sod...

What is the colour of the flame when sodium is subjected to flame test?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos
  • Solved Paper 2017-1

    OSWAAL PUBLICATION|Exercise EXERCISE|56 Videos

Similar Questions

Explore conceptually related problems

Define flame.

What is the product obtained when alkynes are subjected to hydrogenation in the presence of lindlar's catalyst?

take some carbon compounds ( naphthalene , camphor , alcohol ) one by one on a spatula and burn them * observe the nature of the flame and note whether smoke is produced * place a metal plate above the flame . Is there a deposition on the plate in case of any of the compounds ?

What are flame cells?

The alkaline earth metal which imparts apple green colour to bunsen flame when introduced in it in the form of its chloride is

What is the colour imparts when calcium, Barium and strontium undergoes glame test?

The colour given by barium in flame is

OSWAAL PUBLICATION-Solved Paper 2016-1-EXCERSICE
  1. Write an example for the reaction in which K(p)=K(c)

    Text Solution

    |

  2. Give reason.the radius of anion is always greater than neutral atom.

    Text Solution

    |

  3. What is the colour of the flame when sodium is subjected to flame test...

    Text Solution

    |

  4. Write the general electronic configuration of p-block elements.

    Text Solution

    |

  5. Why does BCL3 acts as lewis acid?

    Text Solution

    |

  6. Write the IUPAC name of CH3-C(OH3)2-CH2-CH(CH3)CH-3

    Text Solution

    |

  7. What is the product obtained when alkynes are subjected to hydrogenati...

    Text Solution

    |

  8. Classify the following into pure substance and mixture. Copper(s), HC...

    Text Solution

    |

  9. Calculate the volume occupied by 8.8 g of CO(2) at 31.1^(@)C and 1 bar...

    Text Solution

    |

  10. Give any two difference between sigmaandpi bond.

    Text Solution

    |

  11. What is called diagonal relationship ?

    Text Solution

    |

  12. In goup 14, the tendency of the elements to show +4 oxidation state de...

    Text Solution

    |

  13. Alkyhalide (halo alkane)+sodium.Complete the chemical equation and nam...

    Text Solution

    |

  14. Explain the mechanism of addition of hydrogen bromide to propene.

    Text Solution

    |

  15. What is greenhouse effect?Name any one gas which is responsible for t...

    Text Solution

    |

  16. Give three defects of mendeleev's periodic table.

    Text Solution

    |

  17. Write the electronic configuration of Hydrogen molecule. Calculate its...

    Text Solution

    |

  18. What is sp^2 hybridisation?Illustrate the formation of Ionic bond.

    Text Solution

    |

  19. Define dipole moment.

    Text Solution

    |

  20. Balance the following chemical equation by oxidation number method Fe^...

    Text Solution

    |