Home
Class 11
CHEMISTRY
What is the product obtained when alkyne...

What is the product obtained when alkynes are subjected to hydrogenation in the presence of lindlar's catalyst?

Promotional Banner

Topper's Solved these Questions

  • Sample Paper 8

    OSWAAL PUBLICATION|Exercise Exercise|62 Videos

  • Solved Paper 2017-1

    OSWAAL PUBLICATION|Exercise EXERCISE|56 Videos

Similar Questions

Explore conceptually related problems

The product formed when 1-butene is subjected to the action to HBr in the presence of peroxide is

Name the product obtained when acetaldehyde reacts with hydroxyl amine.

Name the product obtained when Benzene is hydrogenated in presence of heated Nickel catalyst.

What is the major product obtained in the following reaction

What is the major product obtained in the following reaction ?

What is the major product formed when propene reacts with hydrogen bromide?

What are the products obtained from the following reaction?

OSWAAL PUBLICATION-Solved Paper 2016-1-EXCERSICE
  1. Why does BCL3 acts as lewis acid?

    Text Solution

    |

  2. Write the IUPAC name of CH3-C(OH3)2-CH2-CH(CH3)CH-3

    Text Solution

    |

  3. What is the product obtained when alkynes are subjected to hydrogenati...

    Text Solution

    |

  4. Classify the following into pure substance and mixture. Copper(s), HC...

    Text Solution

    |

  5. Calculate the volume occupied by 8.8 g of CO(2) at 31.1^(@)C and 1 bar...

    Text Solution

    |

  6. Give any two difference between sigmaandpi bond.

    Text Solution

    |

  7. What is called diagonal relationship ?

    Text Solution

    |

  8. In goup 14, the tendency of the elements to show +4 oxidation state de...

    Text Solution

    |

  9. Alkyhalide (halo alkane)+sodium.Complete the chemical equation and nam...

    Text Solution

    |

  10. Explain the mechanism of addition of hydrogen bromide to propene.

    Text Solution

    |

  11. What is greenhouse effect?Name any one gas which is responsible for t...

    Text Solution

    |

  12. Give three defects of mendeleev's periodic table.

    Text Solution

    |

  13. Write the electronic configuration of Hydrogen molecule. Calculate its...

    Text Solution

    |

  14. What is sp^2 hybridisation?Illustrate the formation of Ionic bond.

    Text Solution

    |

  15. Define dipole moment.

    Text Solution

    |

  16. Balance the following chemical equation by oxidation number method Fe^...

    Text Solution

    |

  17. Density of water is maximum at 4^(@)C.

    Text Solution

    |

  18. Name the salt which causes temporary hardness of water.

    Text Solution

    |

  19. Give the equation,involved in the manufacture of washing soda by solva...

    Text Solution

    |

  20. Write any three diffferences between graphite and diamond.

    Text Solution

    |