The IUPAC name of compound
`CH_(3)-underset(CH_(2)CH_(3))underset(|)(CH) - CH_(2) - CH (OH) - CH_(3)` is

Options

A. 4-Methylhexan-3-ol
B. Heptan-2-ol
C. 4-Methylhexan-2-ol
D. None of these

Explanation

To determine the IUPAC name of the compound `CH3-CH(CH2CH3)-CH2-CH(OH)-CH3`, we will follow these steps:

### Step 1: Identify the Longest Carbon Chain
The first step is to identify the longest continuous carbon chain in the compound. In this case, the longest chain consists of 6 carbon atoms.

### Step 2: Number the Carbon Chain
Next, we need to number the carbon chain. We will start numbering from the end closest to the functional group (OH group) to give it the lowest possible number.

The numbering will be as follows:
1. CH3 (1)
2. CH (2)
3. CH2 (3)
4. CH (4)
5. CH2 (5)
6. CH3 (6)

### Step 3: Identify Substituents
Now, we identify any substituents attached to the main carbon chain. In this case, there is a methyl group (CH3) attached to the fourth carbon.

### Step 4: Determine the Functional Group
The functional group present in the compound is a hydroxyl group (OH), which is attached to the second carbon of the chain.

### Step 5: Construct the IUPAC Name
Now we can construct the IUPAC name using the following format:
- Start with the substituent: 4-methyl (indicating the methyl group on the fourth carbon).
- Next, use the root name for the longest chain: hex (for six carbons).
- Finally, add the suffix for the functional group: 2-ol (indicating the hydroxyl group on the second carbon).

Putting it all together, the IUPAC name of the compound is:
**4-methyl-2-hexanol**

### Final Answer
The IUPAC name of the compound is **4-methyl-2-hexanol**.

---