Write the IUPAC name of the compound :
`CH_(3)-O-CH_(2)-underset(CH_(3))underset(|)(CH)-CH_(2)-CH_(3)`

Explanation

To determine the IUPAC name of the compound `CH3-O-CH2-CH(CH3)-CH2-CH3`, we will follow these steps:

### Step 1: Identify the Longest Carbon Chain
- Start by identifying the longest continuous carbon chain in the compound. In this case, we can see that the longest chain consists of four carbon atoms.

### Step 2: Number the Carbon Chain
- Number the carbon chain from the end nearest to the substituent to give the substituents the lowest possible numbers.
- In this case, we can number the chain as follows:
...