Ethyl acetate reacts with `NH_2NHCONH_2` to form

Options

A. `CH_3 CONHCONHNH_2`
B. `CH_3CON(NH_2) CONH_2`
C. `CH_3 CONHNHCONH_2`
D. `CH_3 CH_2 NHNHCONH_2`

Explanation

To solve the problem of how ethyl acetate reacts with hydrazinecarboxamide (NH2-NHCO-NH2), we can break down the reaction step by step.

### Step-by-Step Solution:

1. **Identify the Reactants**:
- Ethyl acetate has the structure: CH3COOCH2CH3.
- Hydrazinecarboxamide is NH2-NHCO-NH2.

2. **Nucleophilic Attack**:
- The nitrogen atom in hydrazinecarboxamide (NH2-NHCO-NH2) acts as a nucleophile. The lone pair of electrons on the nitrogen will attack the carbonyl carbon (C=O) of ethyl acetate.
- This results in the formation of a tetrahedral intermediate.

3. **Formation of the Intermediate**:
- The intermediate formed will have the structure: CH3C(OH)(NH2-NHCO-NH2)OCH2CH3.
- Here, the carbonyl oxygen becomes negatively charged, and the nitrogen forms a bond with the carbonyl carbon.

4. **Proton Transfer**:
- A proton (H+) from the nitrogen will be transferred to the negatively charged oxygen, leading to the stabilization of the intermediate.

5. **Elimination of Water**:
- The intermediate can lose a water molecule (H2O) as a result of the rearrangement, leading to the formation of a more stable product.

6. **Final Product**:
- The final product formed from this reaction is CH3CONHNHCO-NH2.
- This compound is known as a hydrazone derivative.

### Final Answer:
The product formed when ethyl acetate reacts with NH2-NHCO-NH2 is CH3CONHNHCO-NH2.