Find out the total number of stereocentre in the given compound.
`CH_3-CH=CH-underset(Br)underset(|)(CH)-underset(Cl)underset(|)(CH)-CH_3`

Explanation

To determine the total number of stereocenters in the given compound, we will analyze the structure step by step.

### Step 1: Understand the Structure
The compound is represented as:
`CH3-CH=CH(Br)-C(Cl)(CH3)-CH3`

We can rewrite it for clarity:
- The first carbon (C1) is attached to three hydrogens (CH3).
- The second carbon (C2) is part of a double bond (CH=).
- The third carbon (C3) is attached to a bromine (Br).
- The fourth carbon (C4) is a chiral center with a chlorine (Cl) and a methyl (CH3) group.
- The fifth carbon (C5) is attached to two hydrogens.

### Step 2: Identify Stereocenters
1. **Chiral Carbons**: A stereocenter (or chiral center) is a carbon atom that is attached to four different groups.
- C4 is a chiral carbon because it has:
- Cl
- CH3
- CH2 (from the chain)
- H
- C2 is also a stereocenter due to the presence of the double bond, where it can exhibit geometrical isomerism (cis/trans).
- C3 is not a stereocenter because it has two identical groups (two hydrogens).

### Step 3: Count the Stereocenters
- **C2**: 1 stereocenter (due to geometrical isomerism).
- **C4**: 1 stereocenter (chiral carbon).

### Total Stereocenters
Adding these up:
- C2 (1) + C4 (1) = 2 stereocenters.

### Final Answer
The total number of stereocenters in the compound is **2**.

---