IUPAC name of `CH_(3)-underset(O)underset(||)(C)-underset(CH_(3))underset(|)underset(C=O)underset(|)(CH)-underset(O)underset(||)(C)-OCH_(3)`

Options

A. Methyl-2, 2-acetyl ethanoate
B. 2,2-acetyl-1-methoxy ethanone
C. Methyl-2-acetyl-3-oxobutanoate
D. none of these

Explanation

To determine the IUPAC name of the compound `CH3-CO-CH(CH3)-C(=O)-OCH3`, we will follow these steps:

### Step 1: Identify the Functional Groups
The compound contains both an ester and a ketone functional group. The presence of these groups will guide the naming process.

**Hint:** Look for the highest priority functional group to determine the base name of the compound.

### Step 2: Determine the Parent Chain
The longest continuous carbon chain that includes the functional groups should be identified. In this case, the longest chain has four carbon atoms.

**Hint:** Count the number of carbon atoms in the longest chain that includes the functional groups.

### Step 3: Number the Carbon Chain
Number the carbon chain starting from the end nearest to the highest priority functional group. In this case, we will start from the end closest to the ester group.

**Hint:** Always number the chain to give the lowest possible numbers to the functional groups.

### Step 4: Identify Substituents
Identify any substituents attached to the main carbon chain. Here, we have a methyl group and an acetyl group.

**Hint:** Look for groups attached to the main chain and note their positions.

### Step 5: Name the Functional Groups
- For the ester group, we will use the suffix "oate."
- For the ketone group, we will use the prefix "oxo."

**Hint:** Remember that the suffix for esters is derived from the alcohol part of the ester.

### Step 6: Combine the Names
Combine the names of the substituents and functional groups with the base name of the parent chain. The order should follow the IUPAC nomenclature rules.

- The base name for the four-carbon chain is "butane."
- The ester part is "methyl" (from the methanol side).
- The ketone part is "oxo."

Thus, we can write the name as: **Methyl 2-acetyl-3-oxo-butanoate.**

### Final IUPAC Name
The final IUPAC name for the compound is **Methyl 2-acetyl-3-oxo-butanoate.**

---