Home
Class 12
CHEMISTRY
Which of the following IUPAC name is inc...

Which of the following IUPAC name is incorrect

A

3-Bromo-2-chloropentane

B

Pent-2-en-4-yne

C

3-Bromo-butan-2-ol

D

1-Aminopentane-2-thiol

Text Solution

AI Generated Solution

The correct Answer is:
To determine which IUPAC name is incorrect, we will analyze each of the provided names step by step. ### Step 1: Analyze the first name - 3-bromo-2-chloropentane 1. **Identify the carbon chain**: The name indicates a pentane, which means there are 5 carbon atoms in the longest chain. 2. **Number the carbon chain**: Start numbering from the end closest to the first substituent (bromo or chloro). - 1: CH3 - 2: CH - 3: CH - 4: CH2 - 5: CH3 3. **Assign substituents**: - Bromo at position 3 - Chloro at position 2 4. **Check the order**: According to IUPAC rules, substituents should be listed in alphabetical order. Since "bromo" comes before "chloro", the name is correctly written as 3-bromo-2-chloropentane. **Conclusion**: This name is correct. ### Step 2: Analyze the second name - pentoene-4-yne 1. **Identify the carbon chain**: The name suggests a pentane structure with both double and triple bonds. 2. **Number the carbon chain**: - If we start from the end with the double bond, we have: - 1: CH - 2: CH - 3: CH - 4: CH2 - 5: CH3 3. **Assign double and triple bonds**: - The double bond is at position 2 and the triple bond at position 4. 4. **Check the naming**: - The correct way to name this compound is to give the double bond the lowest number possible, which means it should be named as pent-3-ene-1-yne (not pentoene-4-yne). **Conclusion**: This name is incorrect. ### Step 3: Analyze the third name - 3-bromobutane-2-ole 1. **Identify the carbon chain**: The name indicates a butane structure with a hydroxyl (OH) group. 2. **Number the carbon chain**: - Start numbering from the end closest to the OH group: - 1: CH2 (with OH) - 2: CH - 3: CH - 4: CH3 3. **Assign substituents**: - Bromo at position 3 and OH at position 2. 4. **Check the order**: The name should be 3-bromobutan-2-ol (the suffix should be "ol" for alcohol). **Conclusion**: This name is correct. ### Step 4: Analyze the fourth name - 1-aminopentane-2-thiol 1. **Identify the carbon chain**: The name indicates a pentane structure with an amino (NH2) group and a thiol (SH) group. 2. **Number the carbon chain**: - Start numbering from the end closest to the thiol group: - 1: CH2 (with SH) - 2: CH (with NH2) - 3: CH2 - 4: CH2 - 5: CH3 3. **Assign substituents**: - Amino at position 1 and thiol at position 2. 4. **Check the order**: The correct name should be 2-thiol-1-aminopentane. **Conclusion**: This name is correct. ### Final Answer The incorrect IUPAC name from the options provided is **pent-4-yne-2-ene**.
Promotional Banner

Topper's Solved these Questions

  • CHEMISTRY AT A GLANCE

    ALLEN|Exercise INORGANIC CHEMISTRY|300 Videos
  • Chemical Equilibrium

    ALLEN|Exercise All Questions|30 Videos
  • ELECTROCHEMISTRY

    ALLEN|Exercise EXERCISE -05 [B]|38 Videos

Similar Questions

Explore conceptually related problems

Which of the following IUPAC name is not correctly matched?

Which of the following IUPAC name is/are correct ?

Which of the following IUPAC names is not correctly matched?

Which of the following IUPAC names are correct.

Which of the following IUPAC name correctly matched ?

Which of the following IUPAC Name is conceptually incorrect?

Which of the following common name incorrect ?

Which of the following is /are incorrect IUPAC name :

Which of the following compounds has incorrect IUPAC nomenclature ?

Which of the following IUPAC names of alkyl radicals is/are correct :

ALLEN-CHEMISTRY AT A GLANCE-ORGANIC CHEMISTRY
  1. IUPAC name of the following compound is CH(3)-CH=CH-CH(2)-C-=CH

    Text Solution

    |

  2. IUPAC name of given compound is

    Text Solution

    |

  3. Which of the following IUPAC name is incorrect

    Text Solution

    |

  4. Number of carbon in parent carbon chain in the following compound

    Text Solution

    |

  5. The correct IUPAC name of following compound is :

    Text Solution

    |

  6. IUPAC name of CH(3)-underset(CH(3))underset(|)(CH)-CH(2)-underset(CH(3...

    Text Solution

    |

  7. The IUPAC name for the compound

    Text Solution

    |

  8. One among the following is the correct IUPAC name for the compound C...

    Text Solution

    |

  9. The correct IUPAC name of HOOC-underset(COOH)underset(|)(CH)-COOH is

    Text Solution

    |

  10. The IUPAC name of the compound

    Text Solution

    |

  11. The correct IUPAC name of the H-overset(O)overset(||)C-overset(O)overs...

    Text Solution

    |

  12. How many cyclic structural isomer of C(5)H(10) are possible

    Text Solution

    |

  13. Among these chain isomers are : (I) CH(3)-CH(3)-CH(2)-CH(2)-OH (II...

    Text Solution

    |

  14. Tautomer of I is

    Text Solution

    |

  15. Draw the structural formulae of all the possible isomers of the compou...

    Text Solution

    |

  16. The total number of cyclic isomers possible for a hydrocarbon with the...

    Text Solution

    |

  17. The number of structural isomers possible from the molecular formula C...

    Text Solution

    |

  18. The number of isomeric carboxylic acids and esters possible for the fo...

    Text Solution

    |

  19. This molecule can be enolized involving :

    Text Solution

    |

  20. Which of the following can exhibit tautomerism:

    Text Solution

    |