Home
Class 12
CHEMISTRY
IUPAC name of CH(3)-underset(CH(3))under...

IUPAC name of `CH_(3)-underset(CH_(3))underset(|)(CH)-CH_(2)-underset(CH_(3))underset(|)(CH)-CH_3` is

Text Solution

AI Generated Solution

The correct Answer is:
To determine the IUPAC name of the given compound `CH₃-CH(CH₃)-CH₂-CH(CH₃)-CH₃`, we will follow these steps: ### Step 1: Identify the longest carbon chain The first step is to identify the longest continuous carbon chain in the structure. In this case, we can see that there are 5 carbon atoms in a straight chain. ### Step 2: Number the carbon chain Next, we need to number the carbon chain. We can start numbering from either end, but we should choose the direction that gives the substituents the lowest possible numbers. - If we number from the left (1 to 5), we get: 1. CH₃ (1) 2. CH (2) 3. CH₂ (3) 4. CH (4) 5. CH₃ (5) - If we number from the right (5 to 1), we get: 1. CH₃ (5) 2. CH (4) 3. CH₂ (3) 4. CH (2) 5. CH₃ (1) In this case, both methods give the same substituent positions. ### Step 3: Identify and name the substituents Now, we need to identify the substituents on the carbon chain. The substituents are methyl groups (CH₃) located at positions 2 and 4 of the main carbon chain. ### Step 4: Combine the names Now we can combine the names of the substituents and the main chain. The main chain is pentane (5 carbon atoms), and since there are two methyl groups at positions 2 and 4, we use the prefix "dimethyl". ### Step 5: Write the final IUPAC name Putting it all together, the IUPAC name of the compound is: **2,4-dimethylpentane**
Promotional Banner

Topper's Solved these Questions

  • CHEMISTRY AT A GLANCE

    ALLEN|Exercise INORGANIC CHEMISTRY|300 Videos
  • Chemical Equilibrium

    ALLEN|Exercise All Questions|30 Videos
  • ELECTROCHEMISTRY

    ALLEN|Exercise EXERCISE -05 [B]|38 Videos

Similar Questions

Explore conceptually related problems

IUPAC name of CH_(3)-underset((CH_(2)CH_(3)))underset(|)CH-CH_(2)-underset(CN)underset(|)CH-CH_(3) is

Write IUPAC name of the compound CH_(3)-underset(CH_(3))underset(|)(CH)-underset(CH_(3))underset(|)(CH)-CH_(3) .

The IUPAC name of CH_(3)-underset(OH)underset(|)(CH)-CH=underset(CH_(3))underset(|)(C )-CHO is

Write its IUPAC name CH_(3)-underset(CH_(3))underset(|)(CH)-CH_(2)-underset(CH_(2))underset(|)overset(CH_(3))overset(|)(C)-CH_(3)

Write the IUPAC name of the compound: CH_(3)-underset(CH_(3))underset(|)CH-CO-underset(CH_(3))underset(|)CH-CH_(3)

IUPAC name of CH_(3)-underset(Cl)underset(|)(C)=CH-CH_(2)-underset(O)underset(||)(C)-CH_(3) is

IUPAC name of CH_(3)-underset(CH_(3))underset(|)C=CH-underset(O)underset(||)C-CH_(3) is

ALLEN-CHEMISTRY AT A GLANCE-ORGANIC CHEMISTRY
  1. Number of carbon in parent carbon chain in the following compound

    Text Solution

    |

  2. The correct IUPAC name of following compound is :

    Text Solution

    |

  3. IUPAC name of CH(3)-underset(CH(3))underset(|)(CH)-CH(2)-underset(CH(3...

    Text Solution

    |

  4. The IUPAC name for the compound

    Text Solution

    |

  5. One among the following is the correct IUPAC name for the compound C...

    Text Solution

    |

  6. The correct IUPAC name of HOOC-underset(COOH)underset(|)(CH)-COOH is

    Text Solution

    |

  7. The IUPAC name of the compound

    Text Solution

    |

  8. The correct IUPAC name of the H-overset(O)overset(||)C-overset(O)overs...

    Text Solution

    |

  9. How many cyclic structural isomer of C(5)H(10) are possible

    Text Solution

    |

  10. Among these chain isomers are : (I) CH(3)-CH(3)-CH(2)-CH(2)-OH (II...

    Text Solution

    |

  11. Tautomer of I is

    Text Solution

    |

  12. Draw the structural formulae of all the possible isomers of the compou...

    Text Solution

    |

  13. The total number of cyclic isomers possible for a hydrocarbon with the...

    Text Solution

    |

  14. The number of structural isomers possible from the molecular formula C...

    Text Solution

    |

  15. The number of isomeric carboxylic acids and esters possible for the fo...

    Text Solution

    |

  16. This molecule can be enolized involving :

    Text Solution

    |

  17. Which of the following can exhibit tautomerism:

    Text Solution

    |

  18. Which among these can exhibit tautomerism ?

    Text Solution

    |

  19. Which of following can exhibit tautomerism?

    Text Solution

    |

  20. Which tautomer isomer is more stable :

    Text Solution

    |