IUPAC name of the compound
`CH_(3)underset(CH_(3))underset(|)overset(CH_(3))overset(|)C-CH_(2)CHO` is

Options

A. 3,3,3-trimethylpropanal
B. 2,2-dimethylbutanal
C. 3,3-dimethylbutanal
D. 1,1-dimethylbutanal

Explanation

To determine the IUPAC name of the compound `CH3-CH(CH3)-CH(CH3)-CH2-CHO`, we will follow the steps outlined in the video transcript. Here’s a step-by-step solution:

### Step 1: Identify the Parent Chain
The first step in naming an organic compound is to identify the longest continuous carbon chain, which will serve as the parent structure.

- In this compound, the longest chain consists of **4 carbon atoms** (butane).

### Step 2: Identify the Functional Group
Next, we need to identify the functional group present in the compound.

- The compound contains an **aldehyde group** (-CHO) at the end of the carbon chain.

### Step 3: Number the Carbon Chain
We will now number the carbon chain. According to IUPAC rules, we should number the chain in such a way that the functional group receives the lowest possible number.

- Starting from the end of the chain that is closest to the aldehyde group, we will number the carbon atoms:
- C1: CHO (aldehyde)
- C2: CH2
- C3: CH(CH3)
- C4: CH(CH3)

### Step 4: Determine the Parent Name
With 4 carbon atoms and an aldehyde functional group, the parent name is derived from butane.

- Since it is an aldehyde, we drop the 'e' from butane and add 'al', resulting in **butanal**.

### Step 5: Identify and Name the Substituents
Now, we need to identify any substituents on the parent chain.

- There are two methyl groups (CH3) attached to the third carbon atom (C3) of the parent chain.

### Step 6: Combine the Names
We will combine the names of the substituents and the parent name according to IUPAC nomenclature rules.

- The substituents are located at the third position, and since there are two methyl groups, we use the prefix "dimethyl".
- Therefore, the full IUPAC name is **3,3-dimethylbutanal**.

### Final Answer
The IUPAC name of the compound `CH3-CH(CH3)-CH(CH3)-CH2-CHO` is **3,3-dimethylbutanal**.

---