Consider the following equilibrium: NH4H...

Consider the following equilibrium: `NH_4HS (s) ⇌ NH_3 (g) + H_2 S (g)` choose the correct relation:

A

`Kp = Kc (RT)^1`

B

`Kp = Kc (RT)^2`

C

`Kp = Kc (RT)^3`

D

Kp = Kc

Text Solution

Verified by Experts

Promotional Banner

Promotional Banner

Recommended Questions

Consider the following equilibrium: NH4HS (s) ⇌ NH3 (g) + H2 S (g) cho...
Text Solution
|
Which of the following is correct for the equilibrium of the reaction ...
Text Solution
|
Calculate the value of KP for the given reactions: NH4HS(s)hArrNH3(g)+...
Text Solution
|
When 5.1g of solid NH4HS is heated at 637K in a closed vessel of volum...
Text Solution
|
For NH4HS(s)hArrNH3(g)+H2S(g) , if Kp = 64 atm^2 , equilibrium pressur...
Text Solution
|
Ammonium hydrogen sulphide dissociated according to the equation, NH...
Text Solution
|
For the reaction Fe2N(s)+(3)/(2)H2(g)=2Fe(s)+NH3(g)
Text Solution
|
Kp for the reaction NH4HS (s) leftrightarrow NH3(g) +H2S (g) at certai...
Text Solution
|
Some solid NH4HS is placed in a flask containing 0.5 atm NH3. What is ...
Text Solution
|