In the following reaction, 4P+3KOH+3H(...

In the following reaction,
`4P+3KOH+3H_(2)O rarr 3KH_(2)PO_(2)+PH_(3)`

A

P is only oxidised

B

P is only reduced

C

P is both oxidised as well as reduced

D

none of the above

Verified by Experts

The correct Answer is:

C

In the following reaction, 4P+3KOH+3H(2)O rarr 3KH(2)PO(2)+PH(3)
Text Solution
|
In the following reaction, 4P+3KOH+3H(2)Orarr3KH(2)PO(2)+PH(3) :
Text Solution
|
In the following reaction, 4P+3KOH+3H(2)O rarr 3KH(2)PO(2)+PH(3)
Text Solution
|
In the chemical reaction CH(3)CH(2)NH(2) + CHCI(3) + 3KOH rarr (A) +...
Text Solution
|
In the chemical reaction, CH(3)CH(2)NH(2)+CHCI(3)+3KOH rarr (A) + 3KCI...
Text Solution
|
In the reaction P + NaOH rarr PH(3) +NaH(2)PO(2)
Text Solution
|
The reaction, P(4)+3NaOH+3H(2)O to 3NaH(2)PO(2)+PH(3) is an example of
Text Solution
|
The reaction P(4)+3NaOH+3H(2)Orarr2NaH(2)PO(2)+PH(3) is an example of
Text Solution
|
What is the nature of the following reaction ? P(4)+3NaOH+3H(2)O to ...
Text Solution
|