Why are most carbon compounds poor condu...

Why are most carbon compounds poor conductors of electricity?

Text Solution

Verified by Experts

Carbon compounds form Covalent bonds/ do not dissociate into /do not have charged particles (ions)

Topper's Solved these Questions

CARBON COMPOUNDS
OSWAL PUBLICATION|Exercise BOARD CORNER ( Long Answer Type Questions)|4 Videos
CARBON COMPOUNDS
OSWAL PUBLICATION|Exercise BOARD CORNER (Very Short Answer Type Questions)|5 Videos
CARBON AND ITS COMPOUNDS
OSWAL PUBLICATION|Exercise CREATING BASED QUESTIONS|23 Videos
CHEMICAL REACTIONS
OSWAL PUBLICATION|Exercise BOARD CORNER (Short Answer Type Questions) |3 Videos

Similar Questions

Explore conceptually related problems

Which of the following statements are correct for carbon compound? (i) Most carbon compounds are good conductors of electricity (ii) Most carbon compounds are poor conductors of electricity (iii) Force of attraction between molecules of carbon compounds is not very strong (iv) Force of attraction between molecules of carbon compounds is very strong

We know that carbon has the unique property to form bonds with other atoms of carbon. Now observe the below given chain of carbon atoms and answer the questions. {:(" |"," |","|"),(-C,-C-,C-),(," |",),(,-C-,),(," |",):} Which of the following statements are correct for carbon compounds? (1) Most carbon compounds are good conductors of electricity. (2) Most carbon compounds are poor conductors of electricity. (3) Force of attraction between molecules of carbon compounds are not very strong. (4) Force of attraction between molecules of carbon compounds are very strong.

What is methane? Draw its electron dot structure. Name the type of bonds formed in this compound. Why are such compounds: (i) poor conductors of electricity? and (ii) have low melting and boiling points? What happens when this compound burns in oxygen.

Assertion : The most of carbon compounds are good conductors of electricity. Reason : They do not dissociate to form ions and remain as molecules.

Assertion (A): Most of the carbon compounds are good conductors of electricity. Reason (R): They do not dissociate to form ions and remain as molecules.

Most of the carbon compounds are good conductors of electricity.

Why are alcohols poor conductors of electricity ?

Why do carbon compounds not conduct electricity ?

OSWAL PUBLICATION-CARBON COMPOUNDS -BOARD CORNER ( Short Answer Type Questions)

Which compounds are called (i) alkanes , (ii) alkenes and (iii) alkyne...
Text Solution
|
A compound 'X' on heating with excess conc. Sulphuric acid at 443 K gi...
Text Solution
|
Why are most carbon compounds poor conductors of electricity?
Text Solution
|
Write the name and structure of a saturated compound in which the carb...
Text Solution
|
Complete the following equations : CH(3)COOC(2)H(5)+NaOHrarr
Text Solution
|
Complete the following equations : CH(3)COOH+NaOHrarr
Text Solution
|
Complete the following chemical equations : C(2)H(5)OH+CH(3)COOHove...
Text Solution
|
Two carbon compound X and Y have the molecular formula C(3)H6 and C(3)...
Text Solution
|
Complete the following equations : CH(3)COOH+Na(2)CO(3)rarr
Text Solution
|
Complete the following equations : CH(4)+O(2)rarr
Text Solution
|
Complete the following equations : C(2)H(5)OH+Nararr
Text Solution
|
Two carbon compound X and Y have the molecular formula C(3)H6 and C(3)...
Text Solution
|
Complete the following chemical equations: C(2)H(5)OH+O(2)rarr
Text Solution
|
Complete the following chemical equations : C(2)H(5)OHunderset(443K...
Text Solution
|
Complete the following chemical equations : CH(3)COON+NaHCO(3)to
Text Solution
|
Two carbon compound X and Y have the molecular formula C(3)H6 and C(3)...
Text Solution
|
Write the structural formula of ethanol. What happens when it is heate...
Text Solution
|
Distinguish between esterification and saponification reactions of org...
Text Solution
|
What happens when ethanol is burnt in air ?
Text Solution
|
What happens when (write chemical equation in each case) ethanol is...
Text Solution
|