Write the IUPAC name of CH(3)-CH=CH-CH...

Write the IUPAC name of
`CH_(3)-CH=CH-CH_(3)`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH=CH-CH_2

Write the IUPAC name of : CH_(2)=CH-CH_(3)

Write the IUPAC name of CH_(3)-CH(CH_3)-C(CH_3)_3

Write the IUPAC name of CH_3-CH_2-CH-(CH_3)_2

Write the IUPAC name of CH_3-CH_2-CH_3

Write the IUPAC name of CH_3-CH-(CH_3)-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH(CH_3)-CH(CH_3)_2

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of (CH_3)_2-CH-CH(CH_3)-CH_2-CH_3

Recommended Questions

Write the IUPAC name of CH(3)-CH=CH-CH(3)
Text Solution
|
Write the IUPAC name of CH(3)CH(2)CH=CH-COOH .
Text Solution
|
The IUPAC name of the compound {:(CH(3)-CH-CH(2)-CH-CH(3)),(" ...
Text Solution
|
IUPAC name of the CH(3)-CH(Br)-CH(CH(3))+COOH is
Text Solution
|
IUPAC name of (CH(3))(2)CH - CH = CH - CH(3) is
Text Solution
|
IUPAC नाम लिखिए- CH(3)-C-=CH
Text Solution
|
IUPAC नाम लिखिए- CH(3)-CH=CH(3)
Text Solution
|
Write the IUPAC name of CH(3) - underset(CH(3))underset(|)(CH) - CH = ...
Text Solution
|
Write IUPAC name CH(3)-underset(CH(3))underset(|)(CH)-underset(OH)unde...
Text Solution
|