Write the IUPAC name of CH3-CH(Cl)-CH(...

Write the IUPAC name of
`CH_3-CH(Cl)-CH(CH_3)-CH_2-CH_3`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(Cl)-CH=CH_2

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-C(CH_3)_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH(Cl)-CH(Br)-CO-CH_2-CH_3

Write the IUPAC name of (CH_3)_2-CH-CH(CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(CHO)-CH(CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH(CH_3)-CH(CH_3)_2

Write the IUPAC name of CH_3-CH_2-CH(CH_3)-O-CH_3

Recommended Questions

Write the IUPAC name of CH3-CH(Cl)-CH(CH3)-CH2-CH3
Text Solution
|
{:(CH3-CH2-,CH-CH2-,CH-CH2-CH2-CH3),(,"|","|"),(,CH3,CH2-CH3):} का IUP...
Text Solution
|
CH3-CH2-CH=CH-CH3 का IUPAC नाम लिखिए ।
Text Solution
|
{:(" "CH3),(" ...
Text Solution
|
CH3-underset(CH3)underset(|)(CH)-CH2-underset(CH3)underset(|)(CH)-CH2-...
Text Solution
|
निम्नलिखित यौगिकों के आई०यू०पी०ए०सी० नाम लिखिए CH3-CH2-CH=CH-CH3
Text Solution
|
What will be the IUPAC name of given compound? {:(" ...
Text Solution
|
The IUPAC name of {:(CH2=CH-CH-CH2-CH3),(" "|)...
Text Solution
|
निम्न का IUPAC नाम है {:(CH3-CH-CH2-CH(OH)-CH3),(" "|),(" ...
Text Solution
|