Write IUPAC Name CH3-CH2-CH2-CH2-C(CH3...

Write IUPAC Name
`CH_3-CH_2-CH_2-CH_2-C(CH_3)-CH=CH_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH(CH_2-CH_3)-CH(CH_2-CH_2-Br)-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-O-CH_2-CH(CH_3)-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH(C(CH_3)_2(CH_2-CH_3))-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH(CH_2-C(CH_3)_3-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH_2-CH(CH_2-C(CH_3)_3)-CH_2-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH_2-CH(CH_2-CH_3)-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH_2-CH(CH_2-CH_2-CH_3)-CH_2-CH_2-CH_3

Recommended Questions

Write IUPAC Name CH3-CH2-CH2-CH2-C(CH3)-CH=CH2
Text Solution
|
{:(CH3-CH2-,CH-CH2-,CH-CH2-CH2-CH3),(,"|","|"),(,CH3,CH2-CH3):} का IUP...
Text Solution
|
What will be the IUPAC name of given compound? {:(" ...
Text Solution
|
The IUPAC name of {:(CH2=CH-CH-CH2-CH3),(" "|)...
Text Solution
|
Write IUPAC names of the {:(CH3(CH2)CH(CH2)CH3),(" "|),(" "CH2-CH(CH3)...
Text Solution
|
निम्न संरचनाओं के IUPAC नाम लिखिए- (8) CH3-CH2-CH2-overset(CI-overset(...
Text Solution
|
निम्न संरचनाओं के IUPAC नाम लिखिए -(9) CH3-CH2-CH2-overset(CI-CH-CH2-B...
Text Solution
|
निम्न का IUPAC नाम है {:(CH3-CH-CH2-CH(OH)-CH3),(" "|),(" ...
Text Solution
|
निम्न में से सही IUPAC नाम है {:(CH3-CH2-CH2-CH2-CH2-CH-overset(CH3)...
Text Solution
|