Write IUPAC Name CH3-CH(CH3)-CH2-CO-N...

Write IUPAC Name
`CH_3-CH(CH_3)-CH_2-CO-NH_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CO-CH(CH_3)-CH_2-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CO-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-NH(CH_3)

Write the IUPAC name of CH_3-C(CH_3)_2-CH_2-CH_2-CH_2-CO-CH_2-CH_3

Write the IUPAC name of CH_3-C(CH_3)_2-CO-CH_2-CH_3

Write the IUPAC name of CH_3-O-CH(CH_3)-CH_2-CH_2-CH_3

IUPAC name is CH_3-CH(CH_3)-CH_2-CH_2-CO-CH_3

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH(CH_3)_2

Write the IUPAC name of CH_3-CH(CH_3)-CH_2-CH(CH_3)-CH(CH_3)-CH_2-CH_3

Recommended Questions

Write IUPAC Name CH3-CH(CH3)-CH2-CO-NH2
Text Solution
|
{:(CH3-CH2-,CH-CH2-,CH-CH2-CH2-CH3),(,"|","|"),(,CH3,CH2-CH3):} का IUP...
Text Solution
|
CH3-CH2-CH(CH3)-CO-CH2-CH2OH का IUPAC नाम है :
Text Solution
|
{:(" "CH3),(" ...
Text Solution
|
CH3-underset(CH3)underset(|)(CH)-CH2-underset(CH3)underset(|)(CH)-CH2-...
Text Solution
|
निम्नलिखित यौगिकों के आई०यू०पी०ए०सी० नाम लिखिएCH3-CH2-CH(NH2)-CH3
Text Solution
|
What will be the IUPAC name of given compound? {:(" ...
Text Solution
|
The IUPAC name of {:(CH2=CH-CH-CH2-CH3),(" "|)...
Text Solution
|
Write IUPAC names of the {:(CH3(CH2)CH(CH2)CH3),(" "|),(" "CH2-CH(CH3)...
Text Solution
|