Write the IUPAC name of the following co...

Write the IUPAC name of the following compound
`CH_(3)-(CH_(2))_(2)-CH_(2)-`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

Write IUPAC name of the following compound (CH_(3)CH_(2))_(2) NCH_(3)

Write IUPAC names of the following compounds : CH_(3)CH_(2)CH_(2)OH

Write IUPAC names of the following compounds : CH_(3)CH=C(CH_(3))_(2)

Write IUPAC name of the following compound : CH_(3)NHCH (CH_(3))_(2)

Write IUPAC names of the following compounds : CH_(3)CH_(2)COOH

Write the IUPAC name of the following compound : CH_(2) = CHCH_(2) Br

Recommended Questions

Write the IUPAC name of the following compound CH(3)-(CH(2))(2)-CH...
Text Solution
|
The IUPAC name of following compound is {:(CH(2)=C-CH(2)-CH(3)),(" |")...
Text Solution
|
Write the IUPAC name of the following compound : CH(3)-O-CH(2)-CH-unde...
Text Solution
|
Write IUPAC name of the following compound (CH(3))(2) N - CH(2) CH(3...
Text Solution
|
निम्नलिखित यौगिक IUPAC नाम है- {:(CH(2)=C-CH(2)-CH(3)),(" ...
Text Solution
|
Write the IUPAC names of the following compounds. CH(3)CH(2)NHCH(2)C...
Text Solution
|
निम्न योगिक के IUPAC नाम लिखिए- CH(3) - CH(2) - Cl
Text Solution
|
निम्नलिखित के IUPAC नाम लिखिएः CH(3)CH(2)CH(2)CH(2)CH(2)OH
Text Solution
|
Write the IUPAC name of the following compound: CH(2)=underset(CH(3))u...
Text Solution
|