What is the IUPAC name of the compound g...

What is the IUPAC name of the compound given below? `(CH_3)_2-C=C(CH_3)-CH(CH_3)_2`

Promotional Banner

Promotional Banner

Similar Questions

Explore conceptually related problems

What is the IUPAC name of the compound given below? C(CH_3)_4

What is the IUPAC name of the compound given below? C(CH_3)_4

What is the IUPAC name of the compound given below? (CH_3)_2C=CH-COCH_3

What is the IUPAC name of the compound given below? (CH_3)_2C=CH(CH_2-CH_3)

What is the IUPAC name of the compound given below? CH_3-CH_2-C-=C-CH_3

What is the IUPAC name of the compound given below? CH_3-CH_2-C-=C-CH_3

What is the IUPAC name of the compound given below? CH_3-CH_2-C(CH_3)_2-CH=CH_2

What is the IUPAC name of the compound given below? (CH_3)_2C=CH-CH_2-Br

What is the IUPAC name of the compound given below? CH_3-CH_2-C(CH_3)_2(CH_2CH_3)

What is the IUPAC name of the compound given below? (CH_3-CH_2)_2CH-CH_3

Recommended Questions

What is the IUPAC name of the compound given below? (CH3)2-C=C(CH3)-C...
Text Solution
|
The IUPAC name of compound CH3-C(CH3)2-CH2-CH=CH2 is
Text Solution
|
CH3-C-=C-CH(CH3)2 का IUPAC नाम है :
Text Solution
|
Write IUPAC names of the following compounds : (i) CH3-C(CH3)-underset...
Text Solution
|
Write the IUPAC name of given compound HC-=C-CH(CH3)2
Text Solution
|
Write the IUPAC names of the following compounds: (i) (CH3)2 CH CH2 ...
Text Solution
|
[(CH3)2-CH]2-C(COCl)CH3 Name the formula in IUPAC?
Text Solution
|
CH3-C(CONH2)(CH3)CH(CH3)2 Name the formula in IUPAC?
Text Solution
|
निम्न यौगिक का IUPAC नाम है {:(CH3-CH-CH2CH2CH3),(" "|),(" ...
Text Solution
|